CAS 148433-01-6
:3-(3-Bromopropoxy)-4-methoxybenzaldehyde
Description:
3-(3-Bromopropoxy)-4-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a methoxy group and an aldehyde functional group. The presence of the bromopropoxy substituent introduces both hydrophobic and polar characteristics, influencing its solubility and reactivity. This compound typically exhibits a moderate to high boiling point due to the presence of the aromatic ring and the aldehyde group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to the reactivity of the aldehyde group. Additionally, the bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Safety data sheets would indicate that it should be handled with care, as it may pose risks associated with brominated compounds, including potential toxicity and environmental impact. Overall, 3-(3-Bromopropoxy)-4-methoxybenzaldehyde is a compound of interest in various chemical research and industrial applications.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c1-14-10-4-3-9(8-13)7-11(10)15-6-2-5-12/h3-4,7-8H,2,5-6H2,1H3
InChI key:InChIKey=CTYOZVWHRKNWGS-UHFFFAOYSA-N
SMILES:O(CCCBr)C1=C(OC)C=CC(C=O)=C1
Synonyms:- Benzaldehyde, 3-(3-bromopropoxy)-4-methoxy-
- 3-(3-Bromopropoxy)-4-methoxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
