
CAS 148439-46-7
:Communesin B
Description:
Communesin B is a naturally occurring chemical compound classified as a secondary metabolite, specifically a type of alkaloid. It is derived from certain fungal species, particularly those belonging to the genus *Penicillium*. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Communesin B has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic effects. Its mechanism of action and specific interactions with biological targets are subjects of ongoing research. The compound is typically studied in the context of natural product chemistry and may have implications for drug development. As with many natural products, the extraction and purification processes can be challenging, and its stability under various conditions is an important consideration for both research and potential therapeutic applications. Overall, Communesin B represents a fascinating area of study within the broader scope of bioactive natural compounds.
Formula:C32H36N4O2
InChI:InChI=1S/C32H36N4O2/c1-5-6-7-15-24(37)35-18-16-31-21-12-8-9-13-22(21)33-28-32(31)17-19-36(29(31)35)26(27-30(2,3)38-27)20-11-10-14-23(25(20)32)34(28)4/h5-15,26-29,33H,16-19H2,1-4H3/b6-5+,15-7+/t26-,27+,28+,29+,31-,32-/m0/s1
InChI key:InChIKey=XZFSMUXVAYCHFO-RPCCRITPSA-N
SMILES:CN1[C@@]2([C@]34[C@]5([C@@]([N@](CC3)[C@@](C6=C4C1=CC=C6)([C@@]7([C@](C)(C)O7)[H])[H])(N(C(/C=C/C=C/C)=O)CC5)[H])C=8C(N2)=CC=CC8)[H]
Synonyms:- Communesin B
- 13,16-Methano-8H,16H-pyrrolo[2′,3′:2,3]pyrido[4,3-o]quinindoline, 17-[(2R)-3,3-dimethyloxiranyl]-1,2,3,8a,9,14,15,16a-octahydro-9-methyl-1-[(2E,4E)-1-oxo-2,4-hexadienyl]-, (3aR,8aR,13bR,16R,16aS,17S)-
- (+)-Communesin B
- 2,4-Hexadien-1-one, 1-[(3aR,8aR,13bR,16R,16aS,17S)-17-[(2R)-3,3-dimethyl-2-oxiranyl]-2,3,8a,9,14,15-hexahydro-9-methyl-13,16-methano-8H,16H-pyrrolo[2′,3′:2,3]pyrido[4,3-o]quinindolin-1(16aH)-yl]-, (2E,4E)-
- (2E,4E)-1-[(3aR,8aR,13bR,16R,16aS,17S)-17-[(2R)-3,3-Dimethyl-2-oxiranyl]-2,3,8a,9,14,15-hexahydro-9-methyl-13,16-methano-8H,16H-pyrrolo[2′,3′:2,3]pyrido[4,3-o]quinindolin-1(16aH)-yl]-2,4-hexadien-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Communesin-B
CAS:<p>Communesin-B is a useful organic compound for research related to life sciences. The catalog number is T125808 and the CAS number is 148439-46-7.</p>Formula:C32H36N4O2Color and Shape:SolidMolecular weight:508.666
