CAS 148461-16-9
:(S)-t-BuPHOX
Description:
(S)-t-BuPHOX, or (S)-tert-butylphosphine oxide, is a chiral phosphine oxide that is widely utilized in asymmetric synthesis and catalysis. This compound features a tert-butyl group attached to a phosphine oxide moiety, which contributes to its steric and electronic properties. The presence of the chiral center allows for the selective formation of enantiomers, making it valuable in the synthesis of pharmaceuticals and fine chemicals. (S)-t-BuPHOX is known for its ability to stabilize transition states in catalytic reactions, particularly in palladium-catalyzed processes. Its solubility in organic solvents and stability under various reaction conditions further enhance its utility in synthetic chemistry. Additionally, the compound's phosphine oxide functionality can participate in various chemical transformations, including coordination with metals, which is crucial for its role as a ligand in catalysis. Overall, (S)-t-BuPHOX is a significant reagent in modern organic synthesis, particularly in the development of chiral compounds.
Formula:C25H26NOP
InChI:InChI=1S/C25H26NOP/c1-25(2,3)23-18-27-24(26-23)21-16-10-11-17-22(21)28(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-17,23H,18H2,1-3H3/t23-/m1/s1
InChI key:InChIKey=DMOLTNKQLUAXPI-HSZRJFAPSA-N
SMILES:P(C1=C(C=CC=C1)C2=N[C@@H](C(C)(C)C)CO2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- (4S)-4-(1,1-Dimethylethyl)-2-[2-(diphenylphosphino)phenyl]-4,5-dihydrooxazole
- (S)-4-tert-Butyl-2-[2-(diphenylphosphino)phenyl]-2-oxazoline
- (S)-t-BuPHOX
- Oxazole, 4-(1,1-dimethylethyl)-2-[2-(diphenylphosphino)phenyl]-4,5-dihydro-, (4S)-
- Oxazole, 4-(1,1-dimethylethyl)-2-[2-(diphenylphosphino)phenyl]-4,5-dihydro-, (S)-
- [2-[(4S)-4-tert-Butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-diphenylphosphane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-4-tert-Butyl-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole
CAS:Formula:C25H26NOPPurity:97%Color and Shape:SolidMolecular weight:387.4538(S)-4-(Tert-Butyl)-2-(2-(Diphenylphosphino)Phenyl)-4,5-Dihydrooxazole
CAS:<p>(S)-4-(Tert-Butyl)-2-(2-(Diphenylphosphino)Phenyl)-4,5-Dihydrooxazole</p>Purity:98%Molecular weight:387.45g/mol(S)-4-(tert-Butyl)-2-[2-(diphenylphosphaneyl)phenyl]-4,5-dihydrooxazole
CAS:Formula:C25H26NOPPurity:>97.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:387.46(S)-4-(tert-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole
CAS:Formula:C25H26NOPPurity:95%Molecular weight:387.463(S)-4-(tert-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole
CAS:<p>(S)-4-(tert-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole is a research chemical with various applications. It has been studied for its potential as an anti-cancer agent, specifically in chemotherapy-induced nausea and vomiting. This compound has shown affinity for the 5-HT3 receptor, which is involved in the regulation of nausea and vomiting. Additionally, (S)-4-(tert-Butyl)-2-(2-(diphenylphosphino)phenyl)-4,5-dihydrooxazole has been used in biomass studies to analyze the composition of cellulose and oligosaccharides. It can also be utilized as an electrode material when combined with lithium hydroxide or hydroxide solutions. Furthermore, this compound has been investigated for its inhibitory effects on angiotensin-converting enzyme, which plays a role in blood pressure regulation. Overall, (S)-</p>Formula:C25H26NOPPurity:Min. 95%Molecular weight:387.46 g/mol





