CAS 148473-36-3
:N-[(2R)-4-(Hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl]-L-isoleucyl-L-leucine
Description:
N-[(2R)-4-(Hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl]-L-isoleucyl-L-leucine, with CAS number 148473-36-3, is a synthetic compound that belongs to the class of peptides and amino acid derivatives. This substance features a complex structure characterized by the presence of a hydroxyamino group, which contributes to its potential biological activity. The compound contains two amino acids, L-isoleucine and L-leucine, which are essential for protein synthesis and play critical roles in various metabolic processes. The dioxo and phenylmethyl substituents suggest that it may exhibit unique interactions with biological targets, potentially influencing its pharmacological properties. Its stereochemistry, indicated by the (2R) configuration, is crucial for its biological function, as the spatial arrangement of atoms can significantly affect how the molecule interacts with enzymes and receptors. Overall, this compound may have applications in medicinal chemistry, particularly in the development of therapeutic agents, although specific biological activities and mechanisms would require further investigation.
Formula:C23H35N3O6
InChI:InChI=1/C23H35N3O6/c1-5-15(4)20(22(29)24-18(23(30)31)11-14(2)3)25-21(28)17(13-19(27)26-32)12-16-9-7-6-8-10-16/h6-10,14-15,17-18,20,32H,5,11-13H2,1-4H3,(H,24,29)(H,25,28)(H,26,27)(H,30,31)/t15-,17+,18-,20-/m0/s1
InChI key:InChIKey=MWZOULASPWUGJJ-NFBUACBFSA-N
SMILES:[C@H](C(N[C@@H](CC(C)C)C(O)=O)=O)(NC([C@H](CC1=CC=CC=C1)CC(NO)=O)=O)[C@H](CC)C
Synonyms:- <span class="text-smallcaps">L</smallcap>-Leucine, N-[(2R)-4-(hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl]-<smallcap>L</span>-isoleucyl-
- <span class="text-smallcaps">L</smallcap>-Leucine, N-[N-[4-(hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl]-<smallcap>L</span>-isoleucyl]-, (R)-
- Jmv 390
- L-Leucine, N-((2R)-4-(hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl)-L-isoleucyl-
- L-Leucine, N-(N-(4-(hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl)-L-isoleucyl)-, (R)-
- N-((2R)-4-(Hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl)-L-isoleucyl-L-leucine
- N-(3-((Hydroxyamino)carbonyl)-2-benzyl-1-oxoprolyl)-L-isoleucine-L-leucine
- N-[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]-L-isoleucyl-L-leucine
- N-[(2R)-4-(Hydroxyamino)-1,4-dioxo-2-(phenylmethyl)butyl]-<span class="text-smallcaps">L</smallcap>-isoleucyl-<smallcap>L</span>-leucine
- JMV 390-1
- Jmv 390 1,Jmv 3901
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
JMV 390-1
CAS:JMV 390-1 is a synthetic analog that functions as a neuropeptide receptor ligand. It is derived through chemical synthesis techniques aimed at modifying the structure of native neuropeptides to enhance specificity and stability. The mode of action of JMV 390-1 involves binding to specific neural receptors, potentially exhibiting agonistic or antagonistic effects depending on the receptor subtype targeted. This interaction can modulate various physiological processes by either mimicking natural neuropeptides or inhibiting their actions.Formula:C23H35N3O6Purity:Min. 95%Molecular weight:449.5 g/molJmv 390-1
CAS:Jmv 390-1 is an inhibitor of metallopeptidase.Formula:C23H35N3O6Purity:98%Color and Shape:SolidMolecular weight:449.54

