CAS 148493-34-9
:2,6-DICHLOROPYRIDINE-3-BORONIC ACID
Description:
2,6-Dichloropyridine-3-boronic acid is an organoboron compound characterized by the presence of both boronic acid and dichloropyridine functional groups. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. The compound features a pyridine ring substituted at the 2 and 6 positions with chlorine atoms, and at the 3 position with a boronic acid group, which is known for its ability to form reversible covalent bonds with diols. This property makes it valuable in various applications, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. Additionally, the presence of chlorine atoms enhances its reactivity and potential for further functionalization. Safety considerations include handling it with care due to potential toxicity and environmental impact. Overall, 2,6-dichloropyridine-3-boronic acid is a versatile compound in synthetic organic chemistry and materials science.
Formula:C5H4BCl2NO2
InChI:InChI=1/C5H4BCl2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2,10-11H
SMILES:c1cc(Cl)nc(c1B(O)O)Cl
Synonyms:- 2,6-Dichloropyridin-3-Ylboronic Acid
- 2,6-Dichloro-3-Pyridyl Boronic Acid
- 2,6-Dichloro-3-Pyridineboronic Acid
- (2,6-Dichloro-3-Pyridinyl)-Boronic Acid
- 2,6-Dichloropyridine-3-Boronic
- 2,6-Dichloro-3-Pyridine Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,6-Dichloropyridine-3-boronic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H4BCl2NO2Purity:95%Color and Shape:Powder, WhiteMolecular weight:191.80Boronic acid, B-(2,6-dichloro-3-pyridinyl)-
CAS:Formula:C5H4BCl2NO2Purity:95%Color and Shape:SolidMolecular weight:191.8078Ref: IN-DA001KYB
1g26.00€5g34.00€10g55.00€1kgTo inquire25g90.00€50g139.00€100g197.00€500gTo inquire250mg26.00€2,6-Dichloropyridine-3-boronic acid
CAS:<p>2,6-Dichloropyridine-3-boronic acid</p>Formula:C5H4BCl2NO2Purity:97%Color and Shape: white powderMolecular weight:191.81g/mol2,6-Dichloropyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H4BCl2NO2Color and Shape:White to Almost white powder to crystalMolecular weight:191.802,6-Dichloropyridine-3-boronic acid
CAS:Formula:C5H4BCl2NO2Purity:95%Color and Shape:SolidMolecular weight:191.8






