CAS 148494-90-0
:1-Phenylpiperidin-3-one
Description:
1-Phenylpiperidin-3-one, with the CAS number 148494-90-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a phenyl group attached to the piperidine ring, specifically at the 1-position, and a ketone functional group at the 3-position. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the phenyl group contributes to its aromatic properties, while the ketone functionality can participate in various chemical reactions, including nucleophilic additions. 1-Phenylpiperidin-3-one is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of various pharmaceuticals. Its structural features suggest potential biological activity, making it a subject of research in drug development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c13-11-7-4-8-12(9-11)10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2
InChI key:CBUHYYSHSILDSD-UHFFFAOYSA-N
SMILES:c1ccc(cc1)N1CCCC(=O)C1
Synonyms:- 1-Phenyl-3-piperidinone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Phenylpiperidin-3-one-d5
CAS:Controlled ProductFormula:C11D5H8NOColor and Shape:NeatMolecular weight:180.258

