CAS 1485-70-7
:N-Benzylbenzamide
Description:
N-Benzylbenzamide is an organic compound characterized by its amide functional group, where a benzyl group is attached to the nitrogen of the amide. It typically appears as a white to off-white crystalline solid and is known for its moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The compound exhibits a melting point that is characteristic of similar aromatic amides, indicating its solid state at room temperature. N-Benzylbenzamide can participate in various chemical reactions, including acylation and nucleophilic substitutions, making it useful in synthetic organic chemistry. Its structure allows for potential interactions in biological systems, which may lead to applications in pharmaceuticals or as intermediates in the synthesis of more complex molecules. Additionally, the presence of both aromatic and amide functionalities contributes to its unique chemical properties, including stability and reactivity under specific conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H13NO
InChI:InChI=1S/C14H13NO/c16-14(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,15,16)
InChI key:InChIKey=LKQUCICFTHBFAL-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=C1)(=O)C2=CC=CC=C2
Synonyms:- Ai3-00504
- Benzamide, N-(phenylmethyl)-
- Benzamide, N-benzyl-
- Benzoic acid benzylamide
- N-(Phenylmethyl)benzamide
- N-Benzoylbenzylamine
- NSC 31622
- N-Benzylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzamide, N-(phenylmethyl)-
CAS:Formula:C14H13NOPurity:98%Color and Shape:SolidMolecular weight:211.2591N-Benzylbenzamide
CAS:N-Benzylbenzamide is a molecule that contains an amide group, which is considered to be a hydrogen bond acceptor. The amine group of this compound can also act as a hydrogen bond donor. It has been shown to inhibit the activity of tyrosinase, which is an enzyme responsible for the production of melanin in melanocytes. N-Benzylbenzamide has been shown to have a molecular mechanism similar to that of hydroquinone and other phenolic compounds. In addition, it has been found to decrease microvessel density and inhibit the growth of cancer cells in vitro. This compound is not yet approved for use as a drug but may be used in future research studies as an alternative treatment for cancer.Formula:C14H13NOPurity:Min. 95%Color and Shape:White PowderMolecular weight:211.26 g/molN-Benzylbenzamide
CAS:Controlled ProductApplications N-BENZYLBENZAMIDE (cas# 1485-70-7) is a useful research chemical.
Formula:C14H13NOColor and Shape:NeatMolecular weight:211.25




