CAS 148504-23-8
:N-[(1S)-3-fluoro-2-oxo-1-(2-phenylethyl)propyl]-Nalpha-(morpholin-4-ylcarbonyl)phenylalaninamide
Description:
N-[(1S)-3-fluoro-2-oxo-1-(2-phenylethyl)propyl]-Nα-(morpholin-4-ylcarbonyl)phenylalaninamide, with CAS number 148504-23-8, is a synthetic organic compound characterized by its complex structure, which includes a fluorinated propyl group, a morpholine moiety, and an amide linkage. This compound features a chiral center, contributing to its stereochemistry, which can influence its biological activity and interactions. The presence of the phenylalanine derivative suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its fluorine atom may enhance metabolic stability and lipophilicity, while the morpholine ring can improve solubility and bioavailability. The compound's unique combination of functional groups indicates potential for diverse interactions with biological targets, making it a candidate for further research in drug development. As with many complex organic compounds, its properties, such as solubility, melting point, and reactivity, would need to be characterized through experimental methods for practical applications.
Formula:C25H30FN3O4
InChI:InChI=1/C25H30FN3O4/c26-18-23(30)21(12-11-19-7-3-1-4-8-19)27-24(31)22(17-20-9-5-2-6-10-20)28-25(32)29-13-15-33-16-14-29/h1-10,21-22H,11-18H2,(H,27,31)(H,28,32)/t21-,22?/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
P 34081
CAS:P 34081 rapidly blocks parasite cysteine proteinase activity in vivo.Formula:C25H30FN3O4Color and Shape:SolidMolecular weight:455.53
