CAS 148546-85-4
:Methyl 3-amino-4,5-dimethoxybenzoate
Description:
Methyl 3-amino-4,5-dimethoxybenzoate, with the CAS number 148546-85-4, is an organic compound characterized by its aromatic structure, which includes a methoxy group and an amino group. This compound features a benzoate moiety, indicating that it is a derivative of benzoic acid, where the carboxylic acid group is esterified with methanol. The presence of the amino group suggests potential for various chemical reactivity, including the ability to participate in nucleophilic substitution reactions. The methoxy groups enhance the compound's solubility in organic solvents and may influence its electronic properties, making it a candidate for applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound's structure may impart specific biological activities, which could be of interest in medicinal chemistry. Overall, Methyl 3-amino-4,5-dimethoxybenzoate is a versatile compound with potential applications in various fields, including drug development and organic synthesis.
Formula:C10H13NO4
InChI:InChI=1S/C10H13NO4/c1-13-8-5-6(10(12)15-3)4-7(11)9(8)14-2/h4-5H,11H2,1-3H3
InChI key:InChIKey=ZDURWSKEQGIEJE-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(N)=CC(C(OC)=O)=C1
Synonyms:- Benzoic acid, 3-amino-4,5-dimethoxy-, methyl ester
- Methyl 3-amino-4,5-dimethoxybenzoate
- 3-Amino-4,5-dimethoxy-benzoic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
