CAS 148565-57-5: Undecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside
Description:Undecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside is a glycoside compound characterized by its unique structure, which includes a long undecyl chain and two glucose units linked through a thioether bond. This compound features a glucopyranosyl moiety at the anomeric position, indicating its glycosidic nature. The presence of the undecyl group contributes to its hydrophobic characteristics, while the glucopyranosyl units enhance its solubility in polar solvents. The thioether linkage imparts stability and can influence the compound's reactivity and biological activity. This substance is of interest in various fields, including biochemistry and pharmacology, due to its potential applications in drug delivery systems and as a surfactant. Its structural complexity may also suggest specific interactions with biological membranes or proteins, making it a candidate for further research in medicinal chemistry. Overall, the combination of hydrophobic and hydrophilic properties in this compound allows for diverse applications in both synthetic and natural product chemistry.
Formula:C23H44O10S
InChI:InChI=1S/C23H44O10S/c1-2-3-4-5-6-7-8-9-10-11-34-23-20(30)18(28)21(15(13-25)32-23)33-22-19(29)17(27)16(26)14(12-24)31-22/h14-30H,2-13H2,1H3/t14-,15-,16-,17+,18-,19-,20-,21-,22-,23+/m1/s1
InChI key:InChIKey=SQISXDUZDUDUNY-GNKAUAAYSA-N
SMILES:OCC1OC(OC2C(O)C(O)C(OC2CO)SCCCCCCCCCCC)C(O)C(O)C1O
- Synonyms:
- Undecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside
- β-D-Glucopyranoside, undecyl 4-O-α-D-glucopyranosyl-1-thio-

β-D-Glucopyranoside, undecyl 4-O-α-D-glucopyranosyl-1-thio-
Ref: IN-DA001L14
Undefined size | To inquire |

n-Undecyl-β-D-Thiomaltopyranoside
Ref: TM-TF0048
Undefined size | To inquire |

Undecyl b-D-thiomaltopyranoside
Ref: 3D-DU06356
1g | 395.00 € | ||
2g | 555.00 € | ||
500mg | 334.00 € |