CAS 148565-58-6
:Dodecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside
Description:
Dodecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside, with the CAS number 148565-58-6, is a glycoside compound characterized by its long hydrophobic dodecyl chain and two glucose units linked through a thioether bond. This structure imparts both surfactant properties and potential biological activity, making it of interest in various applications, including pharmaceuticals and cosmetics. The presence of the glucopyranosyl moieties enhances its solubility in aqueous environments, while the dodecyl group contributes to its lipophilicity. This amphiphilic nature allows it to interact with biological membranes, potentially facilitating drug delivery or acting as a stabilizing agent in formulations. Additionally, the thioether linkage may influence its stability and reactivity compared to other glycosides. Overall, this compound exemplifies the intersection of carbohydrate chemistry and surfactant science, with implications for both industrial and biomedical fields.
Formula:C24H46O10S
InChI:InChI=1S/C24H46O10S/c1-2-3-4-5-6-7-8-9-10-11-12-35-24-21(31)19(29)22(16(14-26)33-24)34-23-20(30)18(28)17(27)15(13-25)32-23/h15-31H,2-14H2,1H3/t15-,16-,17-,18+,19-,20-,21-,22-,23-,24+/m1/s1
InChI key:InChIKey=ONZZYJQRGFMDCX-ALYNCGSASA-N
SMILES:O([C@@H]1[C@@H](CO)O[C@@H](SCCCCCCCCCCCC)[C@H](O)[C@H]1O)[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- Dodecyl 4-O-α-D-glucopyranosyl-1-thio-β-D-glucopyranoside
- β-D-Glucopyranoside, dodecyl 4-O-α-D-glucopyranosyl-1-thio-
- 1-S-Dodecyl β-D-thiomaltopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
n-Dodecyl β-D-thiomaltopyranoside
CAS:n-Dodecyl β-D-thiomaltopyranosideFormula:C24H46O10SPurity:By hplc: 99.7% (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:526.68g/molDodecyl b-D-thiomaltopyranoside
CAS:Dodecyl b-D-thiomaltopyranoside is a surfactant that is used in the formulation of multilayer tablets. It is a glycosidic surfactant and an adsorbent. Dodecyl b-D-thiomaltopyranoside has been shown to form micelles in solution and on electrodes, with the size of the micelle depending on the concentration. The surface area of micelles can be increased by increasing the concentration of electrolytes. Dodecyl b-D-thiomaltopyranoside may also form monolayers at low concentrations, which are less effective for adsorption than micelles.Formula:C24H46O10SPurity:Min. 95%Color and Shape:PowderMolecular weight:526.68 g/moln-Dodecyl-β-D-Thiomaltopyranoside
CAS:n-Dodecyl-β-D-Thiomaltopyranoside is a useful organic compound for research related to life sciences. The catalog number is TF0058 and the CAS number is 148565-58-6.Formula:C24H46O10SColor and Shape:SolidMolecular weight:526.68




