CAS 1486-53-9
:4-BENZYLOXY-3-METHOXYBENZOIC ACID
Description:
4-Benzyloxy-3-methoxybenzoic acid, with the CAS number 1486-53-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a benzyloxy group and a methoxy group. This compound typically exhibits properties associated with aromatic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of the benzyloxy and methoxy substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound may display biological activity, which can be explored in pharmaceutical applications. Its melting point, boiling point, and specific reactivity would depend on the purity and specific conditions under which it is studied. Overall, 4-Benzyloxy-3-methoxybenzoic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C15H13O4
InChI:InChI=1/C15H14O4/c1-18-14-9-12(15(16)17)7-8-13(14)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17)/p-1
SMILES:COc1cc(ccc1OCc1ccccc1)C(=O)[O-]
Synonyms:- Rarechem Al Be 0064
- Benzyl Vanillic Acid
- 4-Benzylvanillic Acid
- 4-(Benzyloxy)-3-Methoxybenzoate
- 4-(benzyloxy)-3-methoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 3-methoxy-4-(phenylmethoxy)-
CAS:Formula:C15H14O4Purity:98%Color and Shape:SolidMolecular weight:258.26934-Benzyloxy-3-Methoxybenzoicacid
CAS:4-Benzyloxy-3-MethoxybenzoicacidPurity:98%Molecular weight:258.27g/mol4-Benzyloxy-3-methoxybenzoic Acid
CAS:Controlled ProductApplications 4-Benzyloxy-3-methoxybenzoic Acid is used in the synthesis of Hsp90 inhibitors as EGCG analogues. Also used in the preparation of vanillates exhibiting cytostatic properties towards cancel cells resistant to pro-apoptotic stimuli.
References Khandelwal, A. et al.: J. Org. Chem., 78, 7859 (2013); Lamoral-Theys, D. et al.: Bioorg. Med. Chem., 18, 3823 (2010);Formula:C15H14O4Color and Shape:NeatMolecular weight:258.274-Benzyloxy-3-methoxybenzoic acid
CAS:4-Benzyloxy-3-methoxybenzoic acid is an isomeric compound that is decarboxylated to 4-hydroxy-3-methoxybenzoic acid. It has been shown to inhibit tumor growth and induce apoptosis in HCT116 human lung cancer cells. The mechanism of action may be due to the inhibition of amine synthesis by vanillyl alcohol and oxygenated metabolites.Formula:C15H14O4Purity:Min. 90%Molecular weight:258.27 g/mol4-Benzyloxy-3-methoxybenzoic acid
CAS:Formula:C15H14O4Purity:98%Color and Shape:SolidMolecular weight:258.273




