CymitQuimica logo

CAS 14861-60-0

:

3-Thiophenemethanol, a-methyl-

Description:
3-Thiophenemethanol, α-methyl- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a methyl group attached to the thiophene ring and a hydroxymethyl group (-CH2OH) at the 3-position of the thiophene. The presence of the hydroxymethyl group contributes to its potential as a functionalized compound in organic synthesis and medicinal chemistry. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is soluble in organic solvents and may exhibit moderate solubility in water due to the hydroxyl group. Its chemical properties include the ability to participate in various reactions, such as oxidation and substitution, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the thiophene moiety can impart unique electronic and photophysical properties, which may be of interest in materials science and organic electronics. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8OS
InChI:InChI=1S/C6H8OS/c1-5(7)6-2-3-8-4-6/h2-5,7H,1H3
InChI key:AJKKZEHIYREOFF-UHFFFAOYSA-N
SMILES:CC(C1=CSC=C1)O
Found 4 products.