CymitQuimica logo

CAS 148619-41-4

:

Ternatin heptapeptide

Description:
Ternatin heptapeptide, identified by the CAS number 148619-41-4, is a synthetic peptide composed of seven amino acids. This compound is notable for its potential biological activities, particularly in the realm of pharmacology and biochemistry. Peptides like Ternatin often exhibit specific interactions with biological receptors, which can lead to various physiological effects. The structure of Ternatin heptapeptide allows it to participate in signaling pathways, potentially influencing processes such as cell growth, differentiation, and immune responses. Its unique sequence of amino acids contributes to its stability and functionality, making it a subject of interest in drug development and therapeutic applications. Additionally, the synthesis and characterization of such peptides are crucial for understanding their mechanisms of action and optimizing their efficacy in clinical settings. As with many peptides, factors such as solubility, stability, and bioavailability are important considerations in their application. Overall, Ternatin heptapeptide represents a fascinating area of study within peptide chemistry and its implications in health sciences.
Formula:C37H67N7O8
InChI:InChI=1/C37H67N7O8/c1-16-22(8)28-37(52)43(14)25(11)35(50)44(15)27(18-20(4)5)32(47)38-26(17-19(2)3)36(51)42(13)24(10)34(49)41(12)23(9)31(46)40-29(33(48)39-28)30(45)21(6)7/h19-30,45H,16-18H2,1-15H3,(H,38,47)(H,39,48)(H,40,46)
SMILES:CCC(C)C1C(=O)N(C)C(C)C(=O)N(C)C(CC(C)C)C(=NC(CC(C)C)C(=O)N(C)C(C)C(=O)N(C)C(C)C(=NC(C(C(C)C)O)C(=N1)O)O)O
Synonyms:
  • Cyclo(-OH-leu-ile-(nme)ala-(nme)leu-leu-(nme)ala-(nme)ala-)
  • Cyclo(OH-leucyl-isoleucyl-(N-methyl)alanyl-(N-methyl)leucyl-leucyl-(N-methyl)alanyl-(N-methyl)alanyl-)
  • cyclo(N-methylalanyl-N-methylleucylleucyl-N-methylalanyl-N-methylalanyl-3-hydroxyleucylisoleucyl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.