CAS 14867-28-8
:3-Iodopropyltrimethoxysilane
Description:
3-Iodopropyltrimethoxysilane, with the CAS number 14867-28-8, is an organosilane compound characterized by its unique structure that includes a propyl chain, an iodine atom, and three methoxy groups attached to a silicon atom. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in forming siloxane bonds with various substrates, making it useful in surface modification and adhesion applications. The presence of the iodine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the trimethoxysilane functionality enables it to bond effectively with siliceous materials, such as glass and ceramics, promoting improved adhesion and durability in coatings and sealants. 3-Iodopropyltrimethoxysilane is also utilized in the synthesis of hybrid organic-inorganic materials and can serve as a coupling agent in polymer composites. Its properties make it valuable in various industrial applications, including electronics, coatings, and construction materials. Proper handling and safety precautions are essential due to its reactivity and potential health hazards.
Formula:C6H15IO3Si
InChI:InChI=1/C6H15IO3Si/c1-8-11(9-2,10-3)6-4-5-7/h4-6H2,1-3H3
SMILES:CO[Si](CCCI)(OC)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(3-Iodopropyl)trimethoxysilane
CAS:Formula:C6H15IO3SiPurity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:290.17Silane, (3-iodopropyl)trimethoxy-
CAS:Formula:C6H15IO3SiPurity:98%Color and Shape:LiquidMolecular weight:290.1715(3-Iodopropyl)Trimethoxysilane
CAS:(3-Iodopropyl)TrimethoxysilanePurity:98%Molecular weight:290.17g/mol3-Iopdopropyl trimethoxysilane
CAS:<p>S10050 - 3-Iopdopropyl trimethoxysilane</p>Formula:C6H15IO3SiPurity:98%Color and Shape:Liquid, Clear LiquidMolecular weight:290.172(3-Iodopropyl)trimethoxysilane
CAS:<p>3-Iodopropyltrimethoxysilane is a multifunctional silane that can be used for the synthesis of polymers with a variety of properties. It reacts with hydroxyl groups, amines, and carboxylic acids to form esters, amides, or urethanes. 3-Iodopropyltrimethoxysilane has been shown to have an uptake in the range of 10-10 mol/L under physiological conditions and has been found to be stable in biological studies. This compound is reactive with hydrogen ions and proton sources such as hydrochloric acid. 3-Iodopropyltrimethoxysilane has been shown to exhibit Toll-like receptor 4 (TLR4) specificity when used as a treatment for nitrogen atoms. The reaction mechanism of this compound is not well understood but it has been proposed that it may involve electrochemical impedance spectroscopy.</p>Formula:C6H15IO3SiPurity:Min. 95%Molecular weight:290.17 g/mol




