CAS 14868-24-7
:2,3-dihydroxy-2-methylbutanoic acid
Description:
2,3-Dihydroxy-2-methylbutanoic acid, with the CAS number 14868-24-7, is an organic compound characterized by the presence of two hydroxyl (-OH) groups and a carboxylic acid (-COOH) functional group. This compound is a derivative of butanoic acid, featuring a branched structure due to the methyl group attached to the second carbon. The hydroxyl groups contribute to its polarity, making it soluble in water and enhancing its reactivity in various chemical reactions, such as esterification and oxidation. The presence of multiple functional groups allows for potential applications in biochemical processes and as a building block in organic synthesis. Additionally, its stereochemistry may influence its biological activity, making it of interest in pharmaceutical research. Overall, 2,3-dihydroxy-2-methylbutanoic acid exhibits properties typical of polyhydroxy acids, including potential antioxidant activity and the ability to participate in hydrogen bonding, which can affect its physical properties and interactions in biological systems.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c1-3(6)5(2,9)4(7)8/h3,6,9H,1-2H3,(H,7,8)
InChI key:InChIKey=AOWPAWLEXIYETE-UHFFFAOYSA-N
SMILES:C(C(C)O)(C(O)=O)(C)O
Synonyms:- 2,3-Dihydroxy-2-methylbutyric acid
- Butanoic acid, 2,3-dihydroxy-2-methyl-
- Butyric acid, 2,3-dihydroxy-2-methyl-
- 2,3-Dihydroxy-2-methylbutanoic acid
- 2-Methyl-2,3-dihydroxybutyric acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,3-Dihydroxy-2-methylbutanoic acid
CAS:2,3-Dihydroxy-2-methylbutanoic acid is a flavonoid that has been shown to have acetylation and ion exchange properties. It is also an enantiopure compound that can be synthesized by techniques including chemoenzymatic or kinetic techniques. 2,3-Dihydroxy-2-methylbutanoic acid can be prepared as either of two stereoisomers, which are dihydroxydimethylbutanoic acid and dihydroxyacetoacetic acid. The synthesis of this substance is typically carried out by trimethylation of the corresponding 3-hydroxypropanoic acid with an ethyl halide followed by hydrolysis of the ester group.Formula:C5H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:134.13 g/mol
