CAS 148688-01-1

1,4-Benzodioxin-5-carboxylic acid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester, hydrochloride (1:1)

Description:

1,4-Benzodioxin-5-carboxylic acid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester, hydrochloride (1:1), with CAS number 148688-01-1, is a chemical compound characterized by its complex structure, which includes a benzodioxin core, an amino group, and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the carboxylic acid and ester functionalities suggests it may participate in various chemical reactions, including esterification and hydrolysis. The hydrochloride form indicates that it is a salt, which can enhance its solubility in polar solvents, making it suitable for pharmaceutical applications. Its structural features may confer specific pharmacological properties, potentially influencing its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural elements positions it as a candidate for further investigation in medicinal chemistry and drug development.

Formula: C₁₉H₂₇ClN₂O₄·ClH

InChI: InChI=1S/C19H27ClN2O4.ClH/c1-2-3-6-22-7-4-13(5-8-22)12-26-19(23)14-11-15(20)16(21)18-17(14)24-9-10-25-18;/h11,13H,2-10,12,21H2,1H3;1H

InChI key: InChIKey=YEQGKAOSYSXEPU-UHFFFAOYSA-N

SMILES: C(OCC1CCN(CCCC)CC1)(=O)C2=C3C(=C(N)C(Cl)=C2)OCCO3.Cl

Synonyms:

• 1,4-Benzodioxin-5-carboxylic acid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester, hydrochloride (1:1)
• 1,4-Benzodioxin-5-carboxylic acid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester, monohydrochloride
• 1,4-Benzodioxin-5-carboxylicacid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester,monohydrochloride (9CI)
• Sb 204070A

SB 204070

CAS: 148688-01-1

SB 204070 is a potent and selective antagonist of the endothelin ETA receptor, which is a type of protein that plays a critical role in various physiological processes. Derived from a chemical synthesis source, this compound interacts with the endothelin system, which is involved in the modulation of vascular tone and cellular proliferation. Its mode of action involves competitive inhibition of the ETA receptor, reducing the physiological effects mediated by endothelins.

Formula: C₁₉H₂₈Cl₂N₂O₄

Purity: Min. 95%

Molecular weight: 419.3 g/mol

Ref: 3D-YFA68801

SB 204070

CAS: 148688-01-1

Potent and selective 5-HT4 receptor antagonist

Formula: C₁₉H₂₈Cl₂N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 419.34

Ref: TM-T23311