
CAS 1487-16-7
:2,3-Dihydro-4,5-dimethylfuran
Description:
2,3-Dihydro-4,5-dimethylfuran is a cyclic ether and a derivative of furan, characterized by its five-membered ring structure containing two double bonds that are saturated in this compound. It has a molecular formula that reflects its composition of carbon and hydrogen atoms, contributing to its hydrophobic nature. This compound is typically a colorless liquid with a distinctive sweet odor, making it of interest in various applications, including as a potential solvent or intermediate in organic synthesis. Its boiling point and density suggest it is relatively volatile and less dense than water. 2,3-Dihydro-4,5-dimethylfuran is known for its reactivity, particularly in electrophilic addition reactions due to the presence of the furan ring, which can participate in various chemical transformations. Additionally, it has been studied for its potential use as a biofuel or in the production of renewable chemicals, highlighting its relevance in sustainable chemistry. Safety data indicates that, like many organic compounds, it should be handled with care to avoid inhalation or skin contact.
Formula:C6H10O
InChI:InChI=1S/C6H10O/c1-5-3-4-7-6(5)2/h3-4H2,1-2H3
InChI key:InChIKey=JKHBEWLCMFXCFW-UHFFFAOYSA-N
SMILES:CC1=C(C)OCC1
Synonyms:- Furan, 2,3-dihydro-4,5-dimethyl-
- 2,3-Dihydro-4,5-dimethylfuran
- NSC 118163
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
