CAS 1487-82-7
:Dimethyltetracyanoquinodimethane; 97%
Description:
Dimethyltetracyanoquinodimethane (DMTQ) is a synthetic organic compound known for its unique electronic properties and is often used in organic electronics and as a charge transfer agent. It features a quinodimethane structure, which contributes to its stability and reactivity. DMTQ is characterized by the presence of four cyano groups, which enhance its electron-accepting capabilities, making it useful in various applications, including organic photovoltaics and as a dopant in conductive polymers. The compound is typically a dark-colored solid at room temperature and is soluble in organic solvents. Its high purity grade of 97% indicates a low level of impurities, which is crucial for research and industrial applications. Safety precautions are necessary when handling DMTQ, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used. Overall, DMTQ is a valuable compound in the field of materials science and organic chemistry due to its distinctive properties and versatility.
Formula:C14H8N4
InChI:InChI=1/C14H8N4/c1-9-3-14(12(7-17)8-18)10(2)4-13(9)11(5-15)6-16/h3-4H,1-2H3
SMILES:Cc1cc(=C(C#N)C#N)c(C)cc1=C(C#N)C#N
Synonyms:- 2,5-Dimethyl-7,7,8,8-tetracyanoquinodimethane
- 2,2'-(2,5-Dimethylcyclohexa-2,5-Diene-1,4-Diylidene)Dipropanedinitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Propanedinitrile, 2,2'-(2,5-dimethyl-2,5-cyclohexadiene-1,4-diylidene)bis-
CAS:Formula:C14H8N4Purity:98%Molecular weight:232.24012,5-Dimethyl-7,7,8,8-tetracyanoquinodimethane
CAS:Formula:C14H8N4Purity:>98.0%(N)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:232.252,2′-(2,5-Dimethylcyclohexa-2,5-diene-1,4-diylidene)dimalononitrile
CAS:Purity:98%Molecular weight:232.24600222,5-Dimethyl-7,7,8,8-tetracyanoquinodimethane
CAS:<p>2,5-Dimethyl-7,7,8,8-tetracyanoquinodimethane is a layered compound that has been modified to have magnetic properties. This modification can be used for research purposes and the magnetically induced transfer of elements between compounds. 2,5-Dimethyl-7,7,8,8-tetracyanoquinodimethane can also be modified by adding an acceptor group to one of the layers in order to create an optical probe. The structural modifications of this molecule make it possible to create a sponge that can be used as a nanoreactor for catalysis or other reactions.</p>Formula:C14H8N4Purity:Min. 95%Color and Shape:PowderMolecular weight:232.25 g/mol



