CAS 148705-09-3
:N-[(2S,3S,4R,5S,6S)-2-[(2S,3S,4S,5S,6S)-2-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)tetrahydropyran-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy
Description:
The chemical substance with the name "N-[(2S,3S,4R,5S,6S)-2-[(2S,3S,4S,5S,6S)-2-[(2S,3S,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)tetrahydropyran-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy" and CAS number "148705-09-3" is a complex organic molecule characterized by multiple stereocenters and hydroxyl groups. This structure suggests it may exhibit significant biological activity, potentially serving as a glycoside or a derivative of a carbohydrate. The presence of nitrophenoxy groups indicates potential for interactions in biological systems, possibly influencing solubility and reactivity. The stereochemistry, denoted by the specific configurations at various carbon centers, is crucial for its biological function, as it can affect how the molecule interacts with enzymes or receptors. Such compounds are often studied for their pharmacological properties, including potential applications in drug development or as biochemical probes. Overall, the intricate structure and functional groups suggest a molecule of considerable interest in medicinal chemistry and biochemistry.
Formula:C32H48N2O23
InChI:InChI=1/C32H48N2O23/c1-10(39)33-17-27(56-31-23(45)21(43)18(40)13(6-35)52-31)19(41)14(7-36)51-29(17)57-28-20(42)15(8-37)53-32(25(28)47)55-26-16(9-38)54-30(24(46)22(26)44)50-12-4-2-11(3-5-12)34(48)49/h2-5,13-32,35-38,40-47H,6-9H2,1H3,(H,33,39)/t13-,14-,15-,16-,17-,18-,19+,20-,21-,22+,23-,24-,25-,26+,27+,28-,29-,30+,31-,32-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Gal β(1-3)GlcNAc β(1-3)Gal β(1-4)Glc-β-pNP
CAS:Formula:C32H48N2O23Purity:97.0%Molecular weight:828.7231Galβ(1-3)GlcNAcβ(1-3)Galβ(1-4)Glc-β-pNP
CAS:Formula:C32H48N2O23Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:828.734-Nitrophenyl lacto-N-tetraoside
CAS:<p>4-Nitrophenyl lacto-N-tetraoside is a chromogenic substrate for enzymes that cleave lactose-specific linkages, such as beta-galactosidases. Upon enzyme cleavage, the pNP group is released, resulting in a yellow-colored solution that can be spectrophotometrically quantified at 405 nm. This substrate is commonly used in detecting lactose hydrolysis activity, such as in dairy industry for production optimization studies, or in microbiology for bacterial lactose fermentation assays. Its tetrasaccharide structure resembles that of lactose and makes it a specific substrate for lactose-utilizing enzymes. The properties of 4-nitrophenyl lacto-N-tetraoside make it a useful tool in enzyme kinetics studies and screening of new lactose-utilizing microorganisms.</p>Purity:Min. 95%Molecular weight:828.72 g/mol



