CAS 14871-92-2

(2,2'-bipyridine)dichloropalladium(ii)

Description:

(2,2'-Bipyridine)dichloropalladium(II), with the CAS number 14871-92-2, is a coordination compound featuring palladium as the central metal ion coordinated to two chloride ions and a bidentate ligand, 2,2'-bipyridine. This compound typically exhibits a square planar geometry, which is characteristic of many d8 metal complexes. It is often used as a catalyst in various organic reactions, including cross-coupling reactions such as the Suzuki and Stille reactions, due to its ability to facilitate the formation of carbon-carbon bonds. The presence of the bipyridine ligand enhances the stability and solubility of the palladium complex in organic solvents. Additionally, (2,2'-bipyridine)dichloropalladium(II) can be sensitive to air and moisture, necessitating careful handling and storage under inert conditions. Its applications extend to fields such as materials science and medicinal chemistry, where it plays a role in synthesizing complex organic molecules. Overall, this compound is significant in both academic research and industrial applications due to its versatile catalytic properties.

Formula: C₁₀H₈Cl₂N₂Pd

InChI: InChI=1/C10H8N2.2ClH.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h1-8H;2*1H;/q;;;+2/p-2

SMILES: c1ccnc(c1)c1ccccn1.Cl.Cl.[Pd]

Synonyms:

• 2,2'-Bipyridine-Dichloropalladium (1:1)

Palladium, (2,2'-bipyridine-κN1,κN1')dichloro-, (SP-4-2)-

CAS: 14871-92-2

Formula: C₁₀H₈Cl₂N₂Pd

Purity: 98%

Color and Shape: Solid

Molecular weight: 333.5099

Ref: IN-DA001L5O

Dichloro(2,2-Bipyridine)Palladium

CAS: 14871-92-2

Dichloro(2,2-Bipyridine)Palladium

Purity: 98%

Molecular weight: 333.51g/mol

Ref: 54-IN10432

(2,2′-Bipyridine)dichloropalladium(II)

CAS: 14871-92-2

Formula: C₁₀H₈Cl₂N₂Pd

Purity: 98%

Color and Shape: Solid

Molecular weight: 333.51

Ref: 10-F240283

(2,2²-Bipyridine)dichloropalladium(II)

Controlled Product

CAS: 14871-92-2

2,2²-Bipyridine)dichloropalladium(II) is a yellow solid that is soluble in organic solvents. It reacts with ketones to form the corresponding 2-aryl-2-oxypalladate esters, which have been found to be useful for the carbonylation of acyl groups. The mechanism of this reaction has been studied using molecular orbital theory and density functional theory calculations. The mechanistic studies have shown that carbonylation occurs via oxidative addition of a Lewis acid like palladium to the carbon atom adjacent to the carbonyl group followed by reductive elimination of HCl. This results in formation of an intermediate allenyl palladium complex that undergoes a dimerization process with release of CO and HCl, leading to the desired product.

Formula: C₁₀H₈Cl₂N₂Pd

Purity: Min. 95%

Molecular weight: 333.51 g/mol

Ref: 3D-PAA87192