CymitQuimica logo

CAS 148763-59-1

:

N-[(5-{[4,6-dideoxy-4-(methylamino)-3-O-pentopyranosylhexopyranosyl]oxy}-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxo-5,6,8,13-tetrahydrobenzo[a]tetracen-2-yl)carbonyl]alanylalanine

Description:
N-[(5-{[4,6-dideoxy-4-(methylamino)-3-O-pentopyranosylhexopyranosyl]oxy}-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxo-5,6,8,13-tetrahydrobenzo[a]tetracen-2-yl)carbonyl]alanylalanine, with CAS number 148763-59-1, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and a significant degree of stereochemistry. This substance features a benzo[a]tetracene core, which is a polycyclic aromatic hydrocarbon, suggesting potential applications in fields such as organic electronics or photonics. The presence of sugar moieties indicates that it may exhibit biological activity, possibly interacting with biological systems or serving as a precursor for further chemical modifications. The compound's multiple hydroxyl groups contribute to its potential solubility in polar solvents and may influence its reactivity and interaction with other molecules. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, highlighting the importance of structural complexity in determining chemical behavior and potential applications.
Formula:C43H49N3O19
InChI:InChI=1/C43H49N3O19/c1-12-7-20-26(33(53)23(12)40(58)45-13(2)39(57)46-14(3)41(59)60)25-18(10-19-27(34(25)54)30(50)17-8-16(61-6)9-21(47)24(17)29(19)49)31(51)37(20)64-43-36(56)38(28(44-5)15(4)63-43)65-42-35(55)32(52)22(48)11-62-42/h7-10,13-15,22,28,31-32,35-38,42-44,47-48,51-56H,11H2,1-6H3,(H,45,58)(H,46,57)(H,59,60)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.