CAS 148796-51-4
:chaetomellic acid A
Description:
Chaetomellic acid A is a naturally occurring compound classified as a secondary metabolite, primarily isolated from certain fungi, particularly those belonging to the genus Chaetomella. This compound is characterized by its unique chemical structure, which includes multiple functional groups that contribute to its biological activity. Chaetomellic acid A has been studied for its potential pharmacological properties, including antimicrobial and cytotoxic effects, making it of interest in medicinal chemistry and drug development. Its molecular structure typically features a complex arrangement of carbon, hydrogen, and oxygen atoms, which may influence its solubility and reactivity. The compound's specific stereochemistry and functional groups are crucial for its interaction with biological targets. Additionally, chaetomellic acid A may exhibit varying degrees of stability under different environmental conditions, which can affect its extraction and application in research. Overall, this compound represents a fascinating area of study within natural products chemistry, with implications for both ecological interactions and potential therapeutic uses.
Formula:C19H34O4
InChI:InChI=1/C19H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19(22)23)16(2)18(20)21/h3-15H2,1-2H3,(H,20,21)(H,22,23)/b17-16-
SMILES:CCCCCCCCCCCCCC/C(=C(\C)/C(=O)O)/C(=O)O
Synonyms:- 2-Butenedioic acid, 2-methyl-3-tetradecyl-, (Z)-
- (2Z)-2-methyl-3-tetradecylbut-2-enedioic acid
- Chaetomellic acid A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chaetomellic acid A
CAS:Chaetomellic acid A inhibits farnesyltransferase (IC50=55nM), not active in cells, and selective over geranylgeranyltransferases (IC50: 92µM, 34µM).Formula:C19H34O4Color and Shape:SolidMolecular weight:326.47
