CAS 148868-55-7
:2-piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate
Description:
2-Piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate, with the CAS number 148868-55-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzoate moiety. This substance typically exhibits properties associated with both amines and esters, making it relevant in medicinal chemistry. The presence of the amino group suggests potential for hydrogen bonding, which can influence solubility and reactivity. The chloro and methoxy substituents on the aromatic ring can affect the compound's electronic properties and steric hindrance, impacting its biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, 2-piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C15H21ClN2O3
InChI:InChI=1/C15H21ClN2O3/c1-20-14-10-13(17)12(16)9-11(14)15(19)21-8-7-18-5-3-2-4-6-18/h9-10H,2-8,17H2,1H3
SMILES:COc1cc(c(cc1C(=O)OCCN1CCCCC1)Cl)N
Synonyms:- 2-(Piperidin-1-yl)ethyl 4-amino-5-chloro-2-methoxybenzoate
- 2-Piperidinoethyl 4-Amino-5-Chloro-2-Methoxybenzoate
- Benzoic Acid, 4-Amino-5-Chloro-2-Methoxy-, 2-(1-Piperidinyl)Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
ML 10302
CAS:ML 10302 is a potent 5-HT4 agonist with Ki of 1.07 nM, boosts bowel movement, and may aid in neurology research.Formula:C15H21ClN2O3Color and Shape:SolidMolecular weight:312.79ML 10302
CAS:Controlled Product<p>Applications ML 10302 is a serotonin 5-HT4 receptor antagonist.<br>References Claeysen, S., et al.: Mol. Pharmacol., 58, 136 (2000);<br></p>Formula:C15H21ClN2O3Color and Shape:NeatMolecular weight:312.79


