CAS 148869-05-0

4-[N-(4-Bromobenzyl)-N-(4-cyanophenyl)amino]-4H-1,2,4-triazole

Description:

4-[N-(4-Bromobenzyl)-N-(4-cyanophenyl)amino]-4H-1,2,4-triazole is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a bromobenzyl group and a cyanophenyl group attached to the triazole, contributing to its potential biological activity and chemical reactivity. The presence of the bromine atom enhances its lipophilicity, which may influence its interaction with biological targets. The cyanophenyl moiety can also impart specific electronic properties, making the compound of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents. Additionally, the compound's stability and solubility characteristics would be important for its practical applications. As with many triazole derivatives, it may exhibit interesting pharmacological properties, warranting further investigation into its mechanism of action and therapeutic potential.

Formula: C₁₆H₁₂BrN₅

InChI: InChI=1/C16H12BrN5/c17-15-5-1-14(2-6-15)10-22(21-11-19-20-12-21)16-7-3-13(9-18)4-8-16/h1-8,11-12H,10H2

InChI key: GGPPBTSXFROGAE-UHFFFAOYSA-N

SMILES: c1cc(ccc1CN(c1ccc(cc1)C#N)n1cnnc1)Br

Synonyms:

• Ym-511
• 4-[N-(4-Bromobenzyl)-N-(1,2,4-triazol-4-yl)amino]benzonitrile
• 4-[(4-bromobenzyl)(4H-1,2,4-triazol-4-yl)amino]benzonitrile

YM 511

CAS: 148869-05-0

YM 511

Formula: C₁₆H₁₂BrN₅

Purity: 99.5%

Molecular weight: 354.2

Ref: 54-BUP12278

YM511

CAS: 148869-05-0

Formula: C₁₆H₁₂BrN₅

Molecular weight: 354.2040

Ref: IN-DA007JBK

YM 511

CAS: 148869-05-0

YM 511 is a specific non-steroidal aromatase inhibitor with IC50s of 0.4 and 0.12 nM, minimally affecting other steroids.

Formula: C₁₆H₁₂BrN₅

Purity: 99.96%

Color and Shape: Solid

Molecular weight: 354.2

Ref: TM-T23549