CAS 148901-52-4
:2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile
Description:
2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile is an organic compound characterized by its complex structure, which includes a fluorine atom, a methylthio group, and a benzonitrile moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The methylthio group, which consists of a sulfur atom bonded to a methyl group, can affect the compound's electronic properties and steric hindrance, potentially impacting its reactivity and interactions with biological targets. The phenoxy group contributes to the compound's overall stability and solubility in organic solvents. This compound is often studied in the context of medicinal chemistry and agrochemicals, where its unique structural features may confer specific pharmacological or herbicidal properties. Its CAS number, 148901-52-4, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound make it a subject of interest in various fields, including pharmaceuticals and materials science.
Formula:C14H10FNOS
InChI:InChI=1/C14H10FNOS/c1-18-11-7-5-10(6-8-11)17-14-4-2-3-13(15)12(14)9-16/h2-8H,1H3
SMILES:CSc1ccc(cc1)Oc1cccc(c1C#N)F
Synonyms:- Fluoromethylthiophenoxybenzonitrile
- 2-Fluoro-6-[4-(Methylsulfanyl)Phenoxy]Benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Fluoro-6-(4-(methylthio)phenoxy)benzonitrile
CAS:Formula:C14H10FNOSColor and Shape:SolidMolecular weight:259.29872-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile
CAS:<p>2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile</p>Formula:C14H10FNOSPurity:techColor and Shape: off white solidMolecular weight:259.30g/mol2-Fluoro-6-[4-(methylthio)phenoxy]benzonitrile
CAS:Formula:C14H10FNOSColor and Shape:Liquid, No data available.Molecular weight:259.3


