CAS 148901-69-3: Ethyl (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate
Description:Ethyl (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate, with CAS number 148901-69-3, is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a cyclopropyl group, and a heptenoate ester. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the quinoline ring, which is known for its pharmacological significance. The hydroxy and keto groups contribute to its reactivity and solubility in various solvents. Ethyl esters generally have moderate volatility and can participate in esterification and hydrolysis reactions. The fluorophenyl substituent may enhance lipophilicity and influence the compound's interaction with biological targets. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C27H26FNO4
InChI:InChI=1/C27H26FNO4/c1-2-33-25(32)16-21(31)15-20(30)13-14-23-26(17-9-11-19(28)12-10-17)22-5-3-4-6-24(22)29-27(23)18-7-8-18/h3-6,9-14,18,20,30H,2,7-8,15-16H2,1H3/b14-13+
InChI key:InChIKey=DPBQVLWVWXLRGW-BUHFOSPRNA-N
SMILES:O=C(OCC)CC(=O)CC(O)C=CC=1C(=NC=2C=CC=CC2C1C=3C=CC(F)=CC3)C4CC4
- Synonyms:
- (E)-7-[2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoic acid ethyl ester
- 6-Heptenoic acid, 7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-, ethyl ester, (6E)-
- 6-Heptenoic acid, 7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-,ethyl ester, (E)-
- Ethyl (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate
- Ethyl (E)-7-[2-cyclopropyl-4-(4-flurophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate
- ethyl (6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate
- Ethyl(E)-7-[4-(4'-fluorophenyl)-2-(cyclopropyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate

6-Heptenoic acid, 7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-, ethyl ester, (6E)-
Ref: IN-DA001L9U
1g | 44.00 € | ||
5g | 83.00 € | ||
25g | 237.00 € |

Pitavastatin 3-Oxo Ethyl Ester
Ref: 4Z-P-6419
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(E)-Ethyl 7-(2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)-5-hydroxy-3-oxohept-6-enoate
Ref: 10-F694898
1g | To inquire | ||
5g | To inquire | ||
25g | To inquire |

Ethyl(E)-7-[2-cyclopropyl-4-(4-flurophenyl)-3-quinolinyl]-5-hydroxy-3-oxo-6-heptenoate
Ref: 3D-FE32909
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |