CAS 148928-15-8
:Fmoc-isonipecotic acid
Description:
Fmoc-isonipecotic acid is a chemical compound characterized by its structure, which includes a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group attached to isonipecotic acid, a derivative of piperidine. This compound is primarily utilized in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with other functional groups. Fmoc-isonipecotic acid is typically a white to off-white solid and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane, but less soluble in water. Its stability under basic conditions makes it a preferred choice in various synthetic pathways. The presence of the isonipecotic acid moiety contributes to its potential biological activity, particularly in the development of pharmaceuticals targeting the central nervous system. As with many chemical substances, handling requires appropriate safety measures due to potential toxicity and reactivity. Overall, Fmoc-isonipecotic acid serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C21H21NO4
InChI:InChI=1/C21H21NO4/c23-20(24)14-9-11-22(12-10-14)21(25)26-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,14,19H,9-13H2,(H,23,24)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1CCC(CC1)C(=O)O
Synonyms:- Fmoc-Inp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-piperidinecarboxylic Acid
CAS:Formula:C21H21NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:351.401-Fmoc-piperidine-4-carboxylic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C21H21NO4Purity:98%Molecular weight:351.401-[(9H-Fluoren-9-ylmethoxy)carbonyl]piperidine-4-carboxylic acid
CAS:<p>1-[(9H-Fluoren-9-ylmethoxy)carbonyl]piperidine-4-carboxylic acid</p>Purity:98%Molecular weight:351.40g/molFmoc-Inp-OH
CAS:<p>M06131 - Fmoc-Inp-OH</p>Formula:C21H21NO4Purity:95%Color and Shape:SolidMolecular weight:351.402





