CAS 148932-68-7

2-Amino-3-methoxybenzonitrile

Description:

2-Amino-3-methoxybenzonitrile, with the CAS number 148932-68-7, is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a nitrile group (-CN) attached to a benzene ring. This compound typically appears as a solid and is soluble in polar organic solvents due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water compared to non-polar compounds. The methoxy group contributes to the compound's electron-donating properties, which can influence its reactivity and interaction with other chemical species. The nitrile group, known for its strong electronegativity, can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Overall, 2-Amino-3-methoxybenzonitrile is of interest in organic synthesis and medicinal chemistry, where it may serve as a building block for more complex molecules or as a potential pharmaceutical agent. Its specific properties, such as melting point and boiling point, would need to be referenced from experimental data for precise applications.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4H,10H2,1H3

SMILES: COc1cccc(C#N)c1N

Synonyms:

• 2-Amino-3-Methoxy Benzonitrile
• Benzonitrile, 2-amino-3-methoxy-
• Benzonitrile, 2-amino-3-methoxy- (9CI)

2-Amino-3-methoxybenzonitrile

CAS: 148932-68-7

Formula: C₈H₈N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA00AC55

2-Amino-3-methoxybenzonitrile

CAS: 148932-68-7

2-Amino-3-methoxybenzonitrile

Purity: 96%

Molecular weight: 148.16g/mol

Ref: 54-OR905652

2-Amino-3-methoxybenzonitrile

CAS: 148932-68-7

Formula: C₈H₈N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 148.165

Ref: 10-F079795