CymitQuimica logo

CAS 1489389-23-2

:

5-[[4-[[(2S)-2-Morpholinylmethyl]amino]-5-(trifluoromethyl)-2-pyridinyl]amino]-2-pyrazinecarbonitrile

Description:
The chemical substance known as 5-[[4-[[(2S)-2-Morpholinylmethyl]amino]-5-(trifluoromethyl)-2-pyridinyl]amino]-2-pyrazinecarbonitrile, with the CAS number 1489389-23-2, is characterized by its complex molecular structure, which includes multiple functional groups such as a pyrazine ring, a pyridine ring, and a morpholine moiety. This compound features a trifluoromethyl group, which is known to enhance lipophilicity and biological activity. The presence of amino groups suggests potential for hydrogen bonding, which can influence solubility and reactivity. The morpholine ring contributes to the compound's pharmacological properties, often associated with increased bioavailability. Additionally, the cyano group (carbonitrile) may impart unique electronic properties, making it a candidate for various chemical reactions. Overall, this compound is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other chemical entities.
Formula:C16H16F3N7O
InChI:InChI=1S/C16H16F3N7O/c17-16(18,19)12-8-25-14(26-15-9-22-10(4-20)5-24-15)3-13(12)23-7-11-6-21-1-2-27-11/h3,5,8-9,11,21H,1-2,6-7H2,(H2,23,24,25,26)/t11-/m0/s1
InChI key:InChIKey=YBYYWUUUGCNAHQ-NSHDSACASA-N
SMILES:N(C[C@@H]1CNCCO1)C=2C(C(F)(F)F)=CN=C(NC=3C=NC(C#N)=CN3)C2
Synonyms:
  • 5-[[4-[[(2S)-2-Morpholinylmethyl]amino]-5-(trifluoromethyl)-2-pyridinyl]amino]-2-pyrazinecarbonitrile
  • 2-Pyrazinecarbonitrile, 5-[[4-[[(2S)-2-morpholinylmethyl]amino]-5-(trifluoromethyl)-2-pyridinyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.