CAS 14894-77-0

2,4,5-Trimethoxybenzonitrile

Description:

2,4,5-Trimethoxybenzonitrile is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with three methoxy groups and a nitrile functional group. The methoxy groups, which are -OCH3, are located at the 2, 4, and 5 positions on the benzene ring, contributing to the compound's overall polarity and reactivity. The presence of the nitrile (-C≡N) group introduces a strong electron-withdrawing characteristic, influencing the compound's chemical behavior and potential applications. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic system. 2,4,5-Trimethoxybenzonitrile may be utilized in various chemical syntheses, including the development of pharmaceuticals and agrochemicals, owing to its functional groups that can participate in further chemical reactions. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry research. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-5H,1-3H3

SMILES: COc1cc(c(cc1C#N)OC)OC

Benzonitrile, 2,4,5-trimethoxy-

CAS: 14894-77-0

Formula: C₁₀H₁₁NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 193.1992

Ref: IN-DA001LAX

2,4,5-Trimethoxybenzonitrile

CAS: 14894-77-0

2,4,5-Trimethoxybenzonitrile

Purity: ≥95%

Molecular weight: 193.20g/mol

Ref: 54-OR49027

2,4,5-Trimethoxybenzonitrile

CAS: 14894-77-0

2,4,5-Trimethoxybenzonitrile is a reagent that is used in organic chemistry. It can be used to cleave a bond between two atoms. It is catalyzed by the presence of azide and nitriles and has been shown to induce cleavage of the C-N bond in etravirine with copper. This compound is also useful for synthesizing nanoparticles from organic compounds.

Formula: C₁₀H₁₁NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 193.20 g/mol

Ref: 3D-FT70580

2,4,5-Trimethoxybenzonitrile

CAS: 14894-77-0

Purity: 97%

Molecular weight: 193.2019958

Ref: 10-F718501