CAS 14897-78-0: 4-Hydroxy-3,5-dimethoxybenzenepropanoic acid
Description:4-Hydroxy-3,5-dimethoxybenzenepropanoic acid, also known as a derivative of phenolic compounds, exhibits several notable characteristics. This compound features a benzene ring substituted with two methoxy groups and a hydroxyl group, contributing to its potential antioxidant properties. The presence of the propanoic acid moiety suggests it may exhibit acidic behavior, with the ability to donate protons in solution. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds of this nature are studied for their biological activities, including anti-inflammatory and antimicrobial effects. The methoxy groups enhance lipophilicity, potentially affecting its bioavailability and interaction with biological membranes. Additionally, the compound may be involved in various synthetic pathways, making it of interest in organic chemistry and pharmaceutical research. Overall, 4-Hydroxy-3,5-dimethoxybenzenepropanoic acid represents a versatile chemical entity with implications in both industrial and medicinal chemistry.
Formula:C11H14O5
InChI:InChI=1S/C11H14O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h5-6,14H,3-4H2,1-2H3,(H,12,13)
InChI key:InChIKey=BPPVOXVSMSXBEI-UHFFFAOYSA-N
SMILES:O=C(O)CCC1=CC(OC)=C(O)C(OC)=C1
- Synonyms:
- 3-(4-Hydroxy-3,5-Dimethoxyphenyl)Propanoic Acid
- 4-Hydroxy-3,5-dimethoxybenzenepropanoic acid
- 4-Hydroxy-3,5-dimethoxyhydrocinnamic acid
- Benzenepropanoic acid, 4-hydroxy-3,5-dimethoxy-
- Dihydrosinapic acid
- Hydrocinnamic acid, 4-hydroxy-3,5-dimethoxy-
- 3-(4-Hydroxy-3,5-dimethoxyphenyl)propionic acid
