CymitQuimica logo

CAS 148983-23-7

:

Carbamic acid, [(2R)-2,3-dihydroxypropyl]-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, [(2R)-2,3-dihydroxypropyl]-, 1,1-dimethylethyl ester, also known by its CAS number 148983-23-7, is an organic compound characterized by its carbamate functional group. This substance features a dihydroxypropyl moiety, which contributes to its potential solubility in polar solvents. The presence of the 1,1-dimethylethyl group imparts steric hindrance, influencing its reactivity and interactions with other molecules. Typically, carbamates exhibit moderate stability under standard conditions but can undergo hydrolysis in the presence of strong acids or bases. This compound may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and the presence of functional groups. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance.
Formula:C8H17NO4
InChI:InChI=1S/C8H17NO4/c1-8(2,3)13-7(12)9-4-6(11)5-10/h6,10-11H,4-5H2,1-3H3,(H,9,12)/t6-/m1/s1
InChI key:OWAMQHJPVUGZSB-ZCFIWIBFSA-N
SMILES:CC(C)(C)OC(=O)NC[C@H](CO)O
Found 4 products.