CAS 148992-43-2

1-Ethoxy-2,2-difluoroethanol

Description:

1-Ethoxy-2,2-difluoroethanol is an organic compound characterized by the presence of an ethoxy group and two fluorine atoms attached to a carbon backbone. Its molecular structure features a hydroxyl (-OH) group, which imparts alcohol-like properties, making it polar and capable of hydrogen bonding. This compound is typically a colorless liquid at room temperature and may have a moderate boiling point due to the presence of both the ethoxy and hydroxyl functional groups. The difluoro substitution enhances its reactivity and can influence its solubility in various solvents, often making it more soluble in polar solvents. Additionally, the presence of fluorine atoms can impart unique properties, such as increased lipophilicity and altered volatility. 1-Ethoxy-2,2-difluoroethanol may be used in various applications, including as a solvent or intermediate in chemical synthesis. However, safety data should be consulted for handling and potential hazards, as fluorinated compounds can exhibit toxicity and environmental persistence.

Formula: C₄H₈F₂O₂

InChI: InChI=1S/C4H8F2O2/c1-2-8-4(7)3(5)6/h3-4,7H,2H2,1H3

InChI key: InChIKey=WEEOMNFWRCDRJI-UHFFFAOYSA-N

SMILES: C(OCC)(C(F)F)O

Synonyms:

• 1-Ethoxy-2,2-Difluoroethanol
• 2,2-Difluoroacetaldehyde ethyl hemiacetal
• Difluoroacetaldehyde ethyl hemiacetal
• Ethanol, 1-ethoxy-2,2-difluoro-
• α,α-Difluoroacetaldehyde ethyl hemiacetal

Difluoroacetaldehyde Ethyl Hemiacetal

CAS: 148992-43-2

Formula: C₄H₈F₂O₂

Purity: >80.0%(NMR)(qNMR)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 126.10

Ref: 3B-D2523

Ethanol, 1-ethoxy-2,2-difluoro-

CAS: 148992-43-2

Formula: C₄H₈F₂O₂

Purity: 90%

Color and Shape: Liquid

Molecular weight: 126.1019

Ref: IN-DA001LBV

Difluoroacetaldehyde ethyl hemiacetal

CAS: 148992-43-2

Formula: C₄H₈F₂O₂

Purity: 90.0%

Color and Shape: Liquid, Clear

Molecular weight: 126.103

Ref: 10-F009136