CAS 149-15-5
:1-Propanol, 3-(dibutylamino)-, 1-(4-aminobenzoate), sulfate (2:1)
Description:
1-Propanol, 3-(dibutylamino)-, 1-(4-aminobenzoate), sulfate (2:1), commonly referred to as a surfactant or emulsifier, is a complex organic compound characterized by its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. This compound typically features a propanol backbone with a dibutylamino group and a 4-aminobenzoate moiety, contributing to its solubility and surface-active properties. The sulfate group enhances its ionic character, making it effective in various applications, including detergents, cosmetics, and pharmaceuticals. Its molecular structure allows for the formation of micelles in solution, facilitating the solubilization of oils and other non-polar substances. Additionally, this compound may exhibit biological activity, influencing its use in drug formulations or as a biochemical agent. Safety and handling considerations are essential due to potential irritant properties, and it is important to consult material safety data sheets (MSDS) for specific guidelines. Overall, this compound plays a significant role in industrial and laboratory settings due to its versatile chemical behavior.
Formula:C18H30N2O2H2O4S
InChI:InChI=1S/C18H30N2O2.H2O4S/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16;1-5(2,3)4/h8-11H,3-7,12-15,19H2,1-2H3;(H2,1,2,3,4)
InChI key:InChIKey=REAJXHWQEFYUCV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.C(OCCCN(CCCC)CCCC)(=O)C1=CC=C(N)C=C1
Synonyms:- 1-Propanol, 3-(dibutylamino)-, 1-(4-aminobenzoate), sulfate (2:1)
- 1-Propanol, 3-(dibutylamino)-, 4-aminobenzoate (ester), sulfate (2:1) (salt)
- 1-Propanol, 3-(dibutylamino)-, 4-aminobenzoate (ester), sulfate (salt) (2:1)
- 1-Propanol, 3-(dibutylamino)-, p-aminobenzoate (ester), sulfate (2:1)
- 3'-Dibutylaminopropyl 4-aminobenzoate sulfate
- 3-(Dibutylamino)-1-propanol p-aminobenzoate (ester) sulfate (2:1)
- 3-(Dibutylamino)-1-propanol-para-aminobenzoate (ester) sulfate (2:1)
- 3-(Dibutylamino)Propyl 4-Aminobenzoate Sulfate (2:1)
- 3-(p-Aminobenzoxy)-1-di-N-butylaminopropane sulfate
- Ai3-02405
- Butacaine hemisulfate
- Butacaine sulfate
- Butelline
- Butyn
- Butyn Sulfate
- Dibutylaminopropyl p-aminobenzoate sulfate
- Unii-Pau39W3Cvb
- p-Aminobenzoyldibutylaminopropanol sulfate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Butacaine sulfate
CAS:Formula:C18H32N2O6SPurity:≥ 98.0%Color and Shape:Off-white solidMolecular weight:404.52Butacaine Sulfate
CAS:Controlled ProductFormula:C18H30N2O2·H2O4SColor and Shape:NeatMolecular weight:710.96Butacaine hemisulfate
CAS:Controlled ProductFormula:C18H30N2O2·H2O4SColor and Shape:NeatMolecular weight:710.96Butacaine Sulphate
CAS:Controlled ProductApplications Butacaine Sulphate (cas# 149-15-5) is a compound useful in organic synthesis.
Formula:C18H30N2O2·H2O4SColor and Shape:Off WhiteMolecular weight:710.96Butacaine sulfate
CAS:Butacaine sulfate is applied to mucous membranes as a local anesthetic.Formula:C18H30N2O2H2O4SColor and Shape:Off-White SolidMolecular weight:355.48





