CAS 149-46-2
:4,5-Dihydroxy-1,3-benzenedisulfonic acid
Description:
4,5-Dihydroxy-1,3-benzenedisulfonic acid, with the CAS number 149-46-2, is an organic compound characterized by the presence of two sulfonic acid groups and two hydroxyl groups on a benzene ring. This compound is a derivative of benzenesulfonic acid and is known for its strong acidity due to the sulfonic acid functional groups. It is typically a white to light yellow crystalline solid that is soluble in water, making it useful in various applications, including as a reagent in organic synthesis and as a dye intermediate. The presence of multiple functional groups allows for a range of chemical reactivity, including potential for complexation with metal ions and participation in redox reactions. Additionally, its hydroxyl groups contribute to its ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. Overall, 4,5-Dihydroxy-1,3-benzenedisulfonic acid is significant in both industrial and laboratory settings due to its versatile chemical properties.
Formula:C6H6O8S2
InChI:InChI=1S/C6H6O8S2/c7-4-1-3(15(9,10)11)2-5(6(4)8)16(12,13)14/h1-2,7-8H,(H,9,10,11)(H,12,13,14)
InChI key:InChIKey=XXAXVMUWHZHZMJ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(S(=O)(=O)O)=CC(O)=C1O
Synonyms:- 1,2-Dihydroxybenzene-3,5-disulfonic acid
- 1,3-Benzenedisulfonic acid, 4,5-dihydroxy-
- 1,3-Benzenedisulfonic acid, 4,5-dihydroxy- (9CI)
- 3,5-Disulfopyrocatechol
- 4,5-Dihydroxy-1,3-benzenedisulfonic acid
- 4,5-Dihydroxy-m-benzenedisulfonic acid
- 4,5-Dihydroxybenzene-1,3-Disulfonic Acid
- 5,6-Dihydroxy-1,3-benzenedisulfonic acid
- Catechol-3,5-disulfonic acid
- Pyrocatechol-3,5-disulfonic acid
- Tiron free acid
- m-Benzenedisulfonic acid, 4,5-dihydroxy-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tiron free acid
CAS:<p>Tiron free acid is a bioactive chemical.</p>Formula:C6H6O8S2Color and Shape:SolidMolecular weight:270.24

