CAS 14900-39-1

1-Phenylvinylboronic acid

Description:

1-Phenylvinylboronic acid is an organoboron compound characterized by the presence of both a vinyl group and a phenyl group attached to a boronic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its structure features a boron atom bonded to a hydroxyl group and an alkene, which contributes to its reactivity, particularly in forming covalent bonds with diols and sugars, making it useful in various applications, including organic synthesis and medicinal chemistry. The boronic acid functionality allows for reversible binding with cis-diols, which is significant in biological systems and for the development of sensors. Additionally, 1-Phenylvinylboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, facilitating the formation of carbon-carbon bonds. Its unique properties make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as with all boronic acids, due to potential irritant effects.

Formula: C₈H₉BO₂

InChI: InChI=1/C8H9BO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-6,10-11H,1H2

SMILES: C=C(c1ccccc1)B(O)O

Synonyms:

• Rarechem Ah Pb 0200
• Alpha-Phenyl Vinylboronic Acid
• Α-Phenyl Vinylboronic Acid
• a-Phenylvinylboronic acid
• (1-Phenylethenyl)Boronic Acid

1-Phenylvinylboronic acid

CAS: 14900-39-1

Formula: C₈H₉BO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.9669

Ref: IN-DA00AP5O

(1-Phenylvinyl)boronic acid

CAS: 14900-39-1

(1-Phenylvinyl)boronic acid

Formula: C₈H₉BO₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 147.97g/mol

Ref: 54-OR4243

(1-Phenylvinyl)boronic acid

CAS: 14900-39-1

Formula: C₈H₉BO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.97

Ref: 10-F242543