
CAS 14901-16-7
:1-Phenyl-3-(2-thiazolyl)-2-thiourea
Description:
1-Phenyl-3-(2-thiazolyl)-2-thiourea, with the CAS number 14901-16-7, is an organic compound characterized by its thiourea functional group, which features a sulfur atom double-bonded to a carbon atom and bonded to two nitrogen atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents. Its structure includes a phenyl group and a thiazole ring, contributing to its potential biological activity. The presence of the thiazole moiety may impart unique properties, such as antimicrobial or antifungal activities, making it of interest in pharmaceutical research. Additionally, thioureas are known for their ability to form coordination complexes with metals, which can be relevant in various chemical applications. The compound's reactivity can be influenced by the substituents on the phenyl and thiazole rings, allowing for modifications that may enhance its efficacy in specific applications. Overall, 1-Phenyl-3-(2-thiazolyl)-2-thiourea is a versatile compound with potential uses in medicinal chemistry and materials science.
Formula:C10H9N3S2
InChI:InChI=1S/C10H9N3S2/c14-9(13-10-11-6-7-15-10)12-8-4-2-1-3-5-8/h1-7H,(H2,11,12,13,14)
InChI key:InChIKey=GCZZOZBWAZHCAN-UHFFFAOYSA-N
SMILES:N(C(NC1=NC=CS1)=S)C2=CC=CC=C2
Synonyms:- Urea, 1-phenyl-3-(2-thiazolyl)-2-thio-
- U 14624
- 1-Phenyl-3-(2-thiazolyl)thiourea
- Thiourea, N-phenyl-N′-2-thiazolyl-
- N-Phenyl-N′-2-thiazolylthiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenylthiazolylthiourea
CAS:Phenylthiazolylthiourea ia a dopamine-beta-hydroxylase inhibitor.Formula:C10H9N3S2Color and Shape:SolidMolecular weight:235.33
