CAS 14902-36-4
:3-O-TOLYL-PROPAN-1-OL
Description:
3-O-Tolyl-propan-1-ol, also known by its IUPAC name, is an organic compound characterized by the presence of a propanol backbone with a tolyl group (derived from toluene) attached to the third carbon. This compound typically exhibits a colorless to pale yellow liquid form and has a moderate boiling point, indicative of its alcohol functional group. It is soluble in organic solvents and exhibits limited solubility in water due to the hydrophobic nature of the tolyl group. The presence of the hydroxyl (-OH) group imparts polar characteristics, allowing for hydrogen bonding, which can influence its reactivity and interactions with other substances. 3-O-Tolyl-propan-1-ol may be utilized in various applications, including as a solvent, in the synthesis of other organic compounds, or in the fragrance industry due to its aromatic properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H14O
InChI:InChI=1/C10H14O/c1-9-5-2-3-6-10(9)7-4-8-11/h2-3,5-6,11H,4,7-8H2,1H3
SMILES:Cc1ccccc1CCCO
Synonyms:- Benzenepropanol, 2-methyl- (9CI)
- 3-(2-Methylphenyl)Propan-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenepropanol, 2-methyl-
CAS:<p>Benzenepropanol, 2-methyl- is an alkoxide that has an X-ray transition and a low reactivity. It can be classified as a polymeric material because of its evolution and chemical composition. The 2-methyl group in the benzenepropanol molecule is responsible for the gelation of this material. Small angle x-ray scattering (SAXS) shows that benzenepropanol, 2-methyl- has a fractal dimension of approximately 1.6. This material's solvents are alkoxides, which can be dissolved in benzene and cyclohexane.</p>Formula:C10H14OPurity:Min. 95%Molecular weight:150.22 g/mol
