CAS 149022-23-1
:benzyl 3,6-di-O-(A-D-mannopyranosyl)-*A-D-mannopy
Description:
Benzyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside is a glycoside compound characterized by the presence of two α-D-mannopyranosyl units attached to a benzyl group. This compound features a glycosidic bond, which is formed between the hydroxyl group of the sugar and the benzyl moiety. The structure indicates that it is a derivative of mannose, a six-carbon aldose sugar, which is known for its role in various biological processes. The presence of multiple hydroxyl groups in the mannopyranosyl units contributes to the compound's hydrophilicity and potential solubility in polar solvents. Additionally, the benzyl group may impart certain hydrophobic characteristics, influencing the compound's overall behavior in biological systems. This compound may exhibit biological activity, potentially interacting with enzymes or receptors due to its sugar moieties, making it of interest in biochemical research and applications. However, specific properties such as melting point, solubility, and reactivity would require empirical data for precise characterization.
Formula:C25H38O16
InChI:InChI=1/C25H38O16/c26-6-11-14(28)17(31)19(33)23(38-11)37-9-13-16(30)22(41-25-20(34)18(32)15(29)12(7-27)39-25)21(35)24(40-13)36-8-10-4-2-1-3-5-10/h1-5,11-35H,6-9H2
SMILES:c1ccc(cc1)COC1C(C(C(C(COC2C(C(C(C(CO)O2)O)O)O)O1)O)OC1C(C(C(C(CO)O1)O)O)O)O
Synonyms:- Benzyl Hexopyranosyl-(1->3)-[Hexopyranosyl-(1->6)]Hexopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
