CAS 14903-90-3
:3-Bromo-2-furoic acid
Description:
3-Bromo-2-furoic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a bromine atom at the 3-position and a carboxylic acid group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid functionality. It exhibits acidic behavior, capable of donating a proton in solution, which is characteristic of carboxylic acids. The bromine substituent can influence the compound's reactivity, making it useful in various chemical synthesis applications, including the development of pharmaceuticals and agrochemicals. Additionally, 3-bromo-2-furoic acid can participate in electrophilic aromatic substitution reactions and can serve as a building block for more complex organic molecules. Its specific applications and reactivity may vary based on the conditions and the presence of other functional groups in a reaction.
Formula:C5H3BrO3
InChI:InChI=1/C5H3BrO3/c6-3-1-2-9-4(3)5(7)8/h1-2H,(H,7,8)
SMILES:c1coc(c1Br)C(=O)O
Synonyms:- 2-Furancarboxylic Acid, 3-Bromo-
- 3-Bromofuran-2-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Furancarboxylic acid, 3-bromo-
CAS:Formula:C5H3BrO3Purity:96%Color and Shape:SolidMolecular weight:190.97953-bromofuran-2-carboxylic acid
CAS:3-bromofuran-2-carboxylic acidPurity:95%Molecular weight:190.98g/mol3-Bromofuran-2-carboxylic acid
CAS:Formula:C5H3BrO3Purity:96%Color and Shape:No data available.Molecular weight:190.983-Bromo-2-furoic Acid
CAS:3-Bromo-2-furoic acid is an intermediate in the synthesis of 3,4-dihydro-2H-pyran. It is produced by the oxidation of 2-furoic acid and can be synthesized by the reaction of furyl with biphenyl. 3-Bromo-2-furoic acid is a competitive inhibitor of glutamate dehydrogenase and glutamate synthetase. Inhibition of these enzymes prevents the conversion of glutamate to glutamine, which leads to elevated levels of glutamate in the brain, resulting in neurotoxicity. 3-Bromo-2-furoic acid also inhibits nicotinic acetylcholine receptors at low concentrations and has been shown to inhibit mitochondrial respiration. This drug has been used to treat hypertension in rats.
Formula:C5H3BrO3Purity:Min. 95%Molecular weight:190.98 g/mol



