CAS 149054-56-8
:4-[[[(E)-[(1,3-Dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino]oxy]methyl]benzoic acid
Description:
4-[[[(E)-[(1,3-Dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino]oxy]methyl]benzoic acid, with the CAS number 149054-56-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a methylene bridge, and a pyrazole ring substituted with a phenoxy group. This compound exhibits properties typical of both organic acids and amines, potentially displaying acidic behavior due to the carboxylic acid group and basic characteristics from the amino group. Its molecular structure suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the dimethyl and phenoxy substituents can enhance lipophilicity, which may affect its biological activity and interaction with various biological targets. Such compounds are often investigated for their potential pharmacological applications, including anti-inflammatory or analgesic properties. However, specific biological activities and safety profiles would require empirical studies to establish their efficacy and toxicity in relevant biological systems.
Formula:C20H19N3O4
InChI:InChI=1S/C20H19N3O4/c1-14-18(19(23(2)22-14)27-17-6-4-3-5-7-17)12-21-26-13-15-8-10-16(11-9-15)20(24)25/h3-12H,13H2,1-2H3,(H,24,25)/b21-12+
InChI key:InChIKey=ZGSVZVKVXOZKSG-CIAFOILYSA-N
SMILES:O(C1=C(/C=N/OCC2=CC=C(C(O)=O)C=C2)C(C)=NN1C)C3=CC=CC=C3
Synonyms:- 4-[[[(E)-[(1,3-Dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino]oxy]methyl]benzoic acid
- Benzoic acid, 4-[[[(E)-[(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino]oxy]methyl]-
- Benzoic acid, 4-[[[[(1,3-dimethyl-5-phenoxy-1H-pyrazol-4-yl)methylene]amino]oxy]methyl]-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-Fenpyroximate (free acid)
CAS:Controlled ProductFormula:C20H19N3O4Color and Shape:NeatMolecular weight:365.38

