CAS 149097-03-0
:urechistachykinin I
Description:
Urechistachykinin I is a neuropeptide that belongs to the tachykinin family, which is characterized by a common C-terminal sequence and is involved in various physiological processes. This peptide is primarily derived from certain species of the phylum Echinodermata, particularly sea cucumbers. Urechistachykinin I is known to play a role in neurotransmission and can influence smooth muscle contraction, vasodilation, and pain perception. Its structure typically includes a sequence of amino acids that contribute to its biological activity, and it interacts with specific receptors in the body, such as neurokinin receptors. The CAS number 149097-03-0 uniquely identifies this compound in chemical databases, facilitating its study and application in research. As a neuropeptide, it may also have implications in various therapeutic areas, including pain management and gastrointestinal function. Overall, urechistachykinin I exemplifies the complexity of neuropeptides and their significant roles in biological systems.
Formula:C50H85N19O14
InChI:InChI=1/C50H85N19O14/c1-25(2)20-28(51)41(76)64-30(13-9-19-60-50(57)58)42(77)65-32(15-17-37(53)73)44(79)68-35(24-71)47(82)66-31(14-16-36(52)72)43(78)67-33(21-27-10-6-5-7-11-27)45(80)69-39(26(3)4)48(83)61-22-38(74)62-34(23-70)46(81)63-29(40(54)75)12-8-18-59-49(55)56/h5-7,10-11,25-26,28-35,39,70-71H,8-9,12-24,51H2,1-4H3,(H2,52,72)(H2,53,73)(H2,54,75)(H,61,83)(H,62,74)(H,63,81)(H,64,76)(H,65,77)(H,66,82)(H,67,78)(H,68,79)(H,69,80)(H4,55,56,59)(H4,57,58,60)/t28-,29-,30-,31-,32-,33-,34-,35-,39-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CO)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](C(C)C)C(=NCC(=N[C@@H](CO)C(=N[C@@H](CCCNC(=N)N)C(=N)O)O)O)O)O)O)O)O)O)O)N
Synonyms:- (2S)-N-[(1S)-2-[[(1S)-4-amino-1-[[(1S)-1-benzyl-2-[[(1S)-1-[[2-[[(1S)-2-[[(1S)-1-carbamoyl-4-guanidino-butyl]amino]-1-(hydroxymethyl)-2-oxo-ethyl]amino]-2-oxo-ethyl]carbamoyl]-2-methyl-propyl]amino]-2-oxo-ethyl]carbamoyl]-4-oxo-butyl]amino]-1-(hydroxymethyl)-2-oxo-ethyl]-2-[[(2S)-2-[[(2S)-2-amino-4-methyl-pentanoyl]amino]-5-guanidino-pentanoyl]amino]pentanediamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Urechistachykinin I
CAS:Urechistachykinin I (Uru-TK I) is an invertebrate kalinin-related peptide (TRPs) isolated from thylakoid nematodes.Formula:C50H85N19O14Purity:98%Color and Shape:SolidMolecular weight:1176.33Urechistachykinin I
CAS:Urechistachykinin I is a diagnostic agent that has been used to detect the presence of bacteria in human serum. It is a peptide analog that is derived from the amino acid sequence of urechistachykinin and has been shown to have receptor activity for inflammatory diseases. The urechistachykinin I molecule can be conjugated with an antibody or other reactive molecule, which allows for its detection in biological fluids. Urechistachykinin I has been shown to inhibit the growth of stenotrophomonas maltophilia, and can be used as a diagnostic agent for this bacterial infection.Formula:C50H85N19O14Purity:Min. 95%Molecular weight:1,176.33 g/mol

