
CAS 149104-88-1
:4-(Methanesulfonyl)phenylboronic acid
Description:
4-(Methanesulfonyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methanesulfonyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is advantageous for various applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in Suzuki coupling reactions for the synthesis of biaryl compounds. Additionally, the methanesulfonyl group enhances the compound's reactivity and solubility, facilitating its use in drug development and as a building block in the synthesis of complex organic molecules. Its unique structural features contribute to its potential applications in pharmaceuticals, particularly in the development of targeted therapies and in the field of materials science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H9BO4S
InChI:InChI=1/C7H9BO4S/c1-13(11,12)7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3
SMILES:CS(=O)(=O)c1ccc(cc1)B(O)O
Synonyms:- 4-Boronophenyl methyl sulphone
- 4-(Methylsulphonyl)phenylboronic acid
- (4-Methylsulfonylphenyl)boronic acid
- 4-[(Dioxo-lambda~6~-sulfanyl)methyl]phenylboronic acid
- 4-(Methylsulfonyl)phenylboronic acid
- 4-(Methylsulfonyl)-benzeneboronic acid
- (4-(Methylsulfonyl)Phenyl)Boronic Acid
- 4-(Methylsulphonyl)Benzeneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Methylsulfonyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H9BO4SPurity:min. 98.0 area%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:200.02Boronic acid, B-[4-(methylsulfonyl)phenyl]-
CAS:Formula:C7H9BO4SPurity:98%Color and Shape:SolidMolecular weight:200.02004-(Methylsulphonyl)benzeneboronic acid
CAS:4-(Methylsulphonyl)benzeneboronic acidPurity:98%Color and Shape:SolidMolecular weight:200.02g/mol4-(Methanesulfonyl)phenylboronic acid
CAS:Formula:C7H9BO4SPurity:98%Color and Shape:White powderMolecular weight:200.02




