CAS 149105-19-1
:2-Carboxyphenylboronic acid
Description:
2-Carboxyphenylboronic acid is an organic compound characterized by the presence of both a carboxylic acid group and a boronic acid group attached to a phenyl ring. Its molecular structure features a phenyl ring with a carboxylic acid (-COOH) group and a boronic acid (-B(OH)2) group positioned at the ortho position relative to each other. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. 2-Carboxyphenylboronic acid is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it acts as a boron source. Additionally, it can form reversible complexes with diols, making it useful in various applications, including drug delivery and sensor technology. Its reactivity and functional groups allow for diverse applications in medicinal chemistry and materials science, highlighting its significance in both academic and industrial research.
Formula:C7H7BO4
InChI:InChI=1/C7H7BO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,11-12H,(H,9,10)
SMILES:c1ccc(c(c1)C(=O)O)B(O)O
Synonyms:- 2-Boronobenzoic acid
- 2-Carboxybenzeneboronic acid
- (2-Dihydroxyboronyl)Benzoic Acid
- 2-(Dihydroxyboryl)Benzoic Acid
- Rarechem Ah Pb 0146
- O-Carboxyphenylboronic Acid
- 2-CarboxyphenylboronicAcid
- 2-(Dihydroxyboranyl)Benzoic Acid
- 2-Carboxyphenylboronic acid ,98%
- 2-CARBOXYPHENYLBORONIC ACID
- 2-CarboxyphenylboronicAcid97+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Carboxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H7BO4Purity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:165.942-Carboxybenzeneboronic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H7BO4Purity:95%Color and Shape:White to off-white, Crystals or powder or crystalline powderMolecular weight:165.942-Carboxybenzeneboronic acid
CAS:2-Carboxybenzeneboronic acidFormula:C7H7BO4Purity:96%Color and Shape: white powderMolecular weight:165.94g/mol2-carboxybenzene boronic acid
CAS:Formula:C7H7BO4Purity:95%Color and Shape:SolidMolecular weight:165.94





