CAS 149108-62-3
:Boronic acid, [5-methoxy-1-[(4-methylphenyl)sulfonyl]-1H-indol-3-yl]-
Description:
Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound you mentioned, with the name "Boronic acid, [5-methoxy-1-[(4-methylphenyl)sulfonyl]-1H-indol-3-yl]-" and CAS number 149108-62-3, features a complex structure that includes an indole moiety, a methoxy group, and a sulfonyl group attached to a phenyl ring. This compound is likely to exhibit properties typical of boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. Additionally, the presence of the sulfonyl group may enhance its solubility and reactivity. Boronic acids are often utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is significant in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's unique structural features suggest potential utility in pharmaceutical development and materials science.
Formula:C16H16BNO5S
InChI:InChI=1S/C16H16BNO5S/c1-11-3-6-13(7-4-11)24(21,22)18-10-15(17(19)20)14-9-12(23-2)5-8-16(14)18/h3-10,19-20H,1-2H3
InChI key:InChIKey=HVTVYGVLSXIXDW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C(B(O)O)=C1)=CC(OC)=CC2)C3=CC=C(C)C=C3
Synonyms:- 5-Methoxy-1-tosyl-3-indoleboronic acid
- Boronic acid, [5-methoxy-1-[(4-methylphenyl)sulfonyl]-1H-indol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
