CAS 149155-70-4
:osmanthuside H
Description:
Osmanthuside H is a chemical compound that belongs to the class of iridoids, which are a type of monoterpenoid. It is primarily derived from the osmanthus plant, known for its fragrant flowers. The compound is characterized by its unique structure, which typically includes a cyclopentane ring fused with a cyclohexene moiety, along with various functional groups that contribute to its biological activity. Osmanthuside H has garnered interest in the field of natural products due to its potential pharmacological properties, including anti-inflammatory and antioxidant effects. Additionally, it may exhibit various biological activities that could be beneficial in medicinal chemistry. The compound's specific interactions and mechanisms of action are subjects of ongoing research, highlighting its significance in both traditional herbal medicine and modern therapeutic applications. As with many natural compounds, the study of osmanthuside H may provide insights into the development of new drugs and health supplements.
Formula:C19H28O11
InChI:InChI=1/C19H28O11/c20-8-19(26)9-29-18(16(19)25)28-7-12-13(22)14(23)15(24)17(30-12)27-6-5-10-1-3-11(21)4-2-10/h1-4,12-18,20-26H,5-9H2/t12-,13-,14+,15-,16+,17-,18-,19-/m1/s1
Synonyms:- 2-(4-Hydroxyphenyl)ethyl-beta-D-apiosyl-(1-6)-beta-D-glucopyranoside
- 2-(4-hydroxyphenyl)ethyl 6-O-[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Osmanthuside H
CAS:Osmanthuside H is a useful organic compound for research related to life sciences. The catalog number is T125796 and the CAS number is 149155-70-4.Formula:C19H28O11Color and Shape:SolidMolecular weight:432.422Osmanthuside H
CAS:Osmanthuside H is a natural compound, specifically a phenylethanoid glycoside, which is predominantly sourced from the plant Osmanthus fragrans, as well as other related species. This compound is characterized by a specific glycosidic linkage that contributes to its stability and bioactivity. The mode of action of Osmanthuside H primarily involves its significant antioxidant properties, attributed to the presence of its phenolic structure and glycosidic moiety. This facilitates its role in scavenging free radicals and reducing oxidative stress within biological systems.Formula:C19H28O11Purity:Min. 95%Molecular weight:432.4 g/mol


