CAS 14918-35-5
:destomycin A
Description:
Destomycin A is a natural antibiotic compound that belongs to the class of polyketides. It is produced by certain strains of the bacterium Streptomyces, which are known for their ability to synthesize a wide variety of bioactive secondary metabolites. Destomycin A exhibits notable antibacterial properties, particularly against Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic development. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Its mechanism of action typically involves interference with bacterial cell wall synthesis or function, although specific pathways may vary. Additionally, destomycin A has been studied for its potential applications in cancer therapy due to its cytotoxic effects on certain tumor cell lines. As with many natural products, the extraction and purification of destomycin A can be challenging, and ongoing research aims to explore its full therapeutic potential and to develop synthetic analogs that may enhance its efficacy and reduce toxicity.
Formula:C20H37N3O13
InChI:InChI=1/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6?,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20-/m1/s1
InChI key:InChIKey=GRRNUXAQVGOGFE-SVNOMHMPSA-N
SMILES:O[C@H]1C2(O[C@]3([C@@](O2)([C@@H](O)[C@@H](CO)O[C@H]3O[C@@H]4[C@@H](O)[C@H](NC)C[C@H](N)[C@H]4O)[H])[H])O[C@]([C@H](CO)N)([C@H](O)[C@@H]1O)[H]
Synonyms:- (3'R,3aS,4S,4'S,5'R,6R,6'R,7S,7aS)-4-{[(1S,2R,3S,5R,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol (non-preferred name)
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-6-amino-6-deoxy-<smallcap>L</smallcap>-glycero-<smallcap>D</smallcap>-galacto-heptopyranosylidene-(1→2-3)-O-β-<smallcap>D</span>-talopyranosyl-(1→5)-2-deoxy-N<sup>1</sup>-methyl-
- Destonate 20
- Destonmycin A
- NSC 96877
- O-6-Amino-6-deoxy-<span class="text-smallcaps">L</smallcap>-glycero-<smallcap>D</smallcap>-galacto-heptopyranosylidene-(1→2-3)-O-β-<smallcap>D</smallcap>-talopyranosyl-(1→5)-2-deoxy-N<sup>1</sup>-methyl-<smallcap>D</span>-streptamine
- Spiro[4H-1,3-dioxolo[4,5-c]pyran-2,2′-[2H]pyran], <span class="text-smallcaps">D</span>-streptamine deriv.
- O-6-Amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1→2-3)-O-β-D-talopyranosyl-(1→5)-2-deoxy-N1-methyl-D-streptamine
- Destomycin A
- D-Streptamine, O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1→2-3)-O-β-D-talopyranosyl-(1→5)-2-deoxy-N1-methyl-
- Spiro[4H-1,3-dioxolo[4,5-c]pyran-2,2′-[2H]pyran], D-streptamine deriv.
- 5)-2-deoxy-N1-methyl-
- DestoMycin
- 2-3)-O-b-D-talopyranosyl-(1®
- destomycin A USP/EP/BP
- D-Streptamine,O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1®
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Destomycin A
CAS:Destomycin A, an aminoglycoside antibiotic, exhibits activity against bacterial (Gram-positive and Gram-negative), antifungal, and anthelmintic agents. It inhibits peptide synthesis in Escherichia coli cells and stimulates adenylate cyclase in animal tissues.Formula:C20H37N3O13Color and Shape:SolidMolecular weight:527.52Destomycin A
CAS:<p>Destomycin A is an antibiotic, which is derived from the bacterium Streptomyces species. This compound exhibits a broad-spectrum mode of action by inhibiting protein synthesis in bacterial cells, thus impeding their growth and proliferation. Destomycin A targets the ribosomal subunits within bacterial cells, leading to disruption in their ability to synthesize essential proteins, ultimately contributing to its bacteriostatic effects.</p>Formula:C20H37N3O13Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:527.52 g/mol

