CAS 149184-22-5

benzyl[(2S)-3-{[(1S)-1-(3,4-dichlorophenyl)ethyl]amino}-2-hydroxypropyl]phosphinic acid

Description:

Benzyl[(2S)-3-{[(1S)-1-(3,4-dichlorophenyl)ethyl]amino}-2-hydroxypropyl]phosphinic acid, with CAS number 149184-22-5, is a phosphinic acid derivative characterized by its complex structure, which includes a phosphinic acid functional group, a benzyl moiety, and a chiral center. This compound typically exhibits properties associated with phosphinic acids, such as potential biological activity and the ability to act as a ligand in various chemical reactions. The presence of the dichlorophenyl group suggests that it may have significant hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the chiral centers in the molecule indicate that it may exist in enantiomeric forms, which can lead to different biological activities or pharmacological effects. Its specific applications may include use in medicinal chemistry or as a biochemical tool, although detailed studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₈H₂₂Cl₂NO₃P

InChI: InChI=1/C18H22Cl2NO3P/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14/h2-9,13,16,21-22H,10-12H2,1H3,(H,23,24)/t13-,16-/m0/s1

SMILES: C[C@@H](c1ccc(c(c1)Cl)Cl)NC[C@@H](CP(=O)(Cc1ccccc1)O)O

Synonyms:

• Phosphinic acid, P-[(2S)-3-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]-P-(phenylmethyl)-
• Benzyl[(2S)-3-{[(1S)-1-(3,4-dichlorophenyl)ethyl]amino}-2-hydroxypropyl]phosphinic acid

CGP 55845 Hydrochloride

Controlled Product

CAS: 149184-22-5

Formula: C₁₈H₂₃Cl₃NO₃P

Color and Shape: Neat

Molecular weight: 345.861

Ref: TR-C291770

CGP 55845 hydrochloride

CAS: 149184-22-5

GABA(B) receptor antagonist

Formula: C₁₈H₂₂Cl₂NO₃P·HCl

Purity: Min. 95%

Molecular weight: 438.71 g/mol

Ref: 3D-BC162622

CGP 55845 hydrochloride

CAS: 149184-22-5

CGP55845 hydrochloride is a potent and selective GABAB receptor antagonist with an IC 50 of 6 nM which can be used in neurological research [1] [2].

Formula: C₁₈H₂₃Cl₃NO₃P

Color and Shape: Solid

Molecular weight: 438.71

Ref: TM-T21759