CAS 14919-49-4
:3,4'-DIHYDROXYFLAVONE
Description:
3,4'-Dihydroxyflavone, with the CAS number 14919-49-4, is a flavonoid compound characterized by the presence of two hydroxyl groups at the 3 and 4' positions of the flavone backbone. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems. It is known for its antioxidant properties, which allow it to scavenge free radicals and potentially contribute to various health benefits. Additionally, 3,4'-dihydroxyflavone may exhibit anti-inflammatory and neuroprotective effects, making it of interest in pharmacological research. The compound is soluble in organic solvents and has limited solubility in water, which is typical for many flavonoids. Its structural features contribute to its biological activity, and it is often studied in the context of natural products and their applications in medicine and nutrition. Overall, 3,4'-dihydroxyflavone represents a significant compound within the flavonoid class, with potential implications for health and disease management.
Formula:C15H10O4
InChI:InChI=1/C15H10O4/c16-10-7-5-9(6-8-10)15-14(18)13(17)11-3-1-2-4-12(11)19-15/h1-8,16,18H
SMILES:c1ccc2c(c1)c(=O)c(c(c1ccc(cc1)O)o2)O
Synonyms:- 4'-Hydroxyflavonol
- 4',3-Dihydroxyflavone
- 3-hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,4'-Dihydroxyflavone
CAS:Formula:C15H10O4Purity:>97.0%(GC)Color and Shape:White to Amber to Dark green powder to crystalMolecular weight:254.244H-1-Benzopyran-4-one, 3-hydroxy-2-(4-hydroxyphenyl)-
CAS:Formula:C15H10O4Purity:97%Color and Shape:SolidMolecular weight:254.23753-Hydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-One
CAS:3-Hydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-OnePurity:>97.0%Molecular weight:254.24g/mol4'-Hydroxyflavonol
CAS:4'-Hydroxyflavonol is a flavonoid compound, which is a naturally occurring phenolic structure commonly found in various plants. It is derived from sources such as fruits, vegetables, and certain medicinal herbs known for their rich polyphenolic content. The mode of action of 4'-Hydroxyflavonol primarily involves its antioxidant properties. It is capable of scavenging free radicals and chelating metal ions, thus protecting cells from oxidative stress and potential damage. Additionally, it may influence signaling pathways related to inflammation and immune response.Formula:C15H10O4Color and Shape:Slightly Yellow PowderMolecular weight:254.24 g/mol3,4'-Dihydroxyflavone
CAS:3,4'-Dihydroxyflavone (3,4'-DHF) is an oral active flavonoid. 3,4'-Dihydroxyflavone (3,4'-DHF) shows antiviral activity against Influenza A virus.Formula:C15H10O4Purity:98.33%Color and Shape:SolidMolecular weight:254.24





